|
Name |
Deoxysporothric acid
|
Molecular Formula | C13H20O4 | |
IUPAC Name* |
2-[(3R,5R)-5-hexyl-2-oxooxolan-3-yl]prop-2-enoic acid
|
|
SMILES |
CCCCCC[C@@H]1C[C@@H](C(=O)O1)C(=C)C(=O)O
|
|
InChI |
InChI=1S/C13H20O4/c1-3-4-5-6-7-10-8-11(13(16)17-10)9(2)12(14)15/h10-11H,2-8H2,1H3,(H,14,15)/t10-,11-/m1/s1
|
|
InChIKey |
RHVCCGGUZCFSLF-GHMZBOCLSA-N
|
|
Synonyms |
Deoxysporothric acid; CHEMBL4171092
|
|
CAS | NA | |
PubChem CID | 139589830 | |
ChEMBL ID | CHEMBL4171092 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 240.29 | ALogp: | 3.3 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 63.6 | Aromatic Rings: | 1 |
Heavy Atoms: | 17 | QED Weighted: | 0.421 |
Caco-2 Permeability: | -4.88 | MDCK Permeability: | 0.00002670 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.022 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.109 |
Blood-Brain-Barrier Penetration (BBB): | 0.138 | Plasma Protein Binding (PPB): | 98.30% |
Volume Distribution (VD): | 0.239 | Fu: | 2.22% |
CYP1A2-inhibitor: | 0.057 | CYP1A2-substrate: | 0.847 |
CYP2C19-inhibitor: | 0.027 | CYP2C19-substrate: | 0.608 |
CYP2C9-inhibitor: | 0.385 | CYP2C9-substrate: | 0.972 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.161 |
CYP3A4-inhibitor: | 0.011 | CYP3A4-substrate: | 0.058 |
Clearance (CL): | 0.972 | Half-life (T1/2): | 0.874 |
hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.231 |
Drug-inuced Liver Injury (DILI): | 0.935 | AMES Toxicity: | 0.007 |
Rat Oral Acute Toxicity: | 0.919 | Maximum Recommended Daily Dose: | 0.049 |
Skin Sensitization: | 0.4 | Carcinogencity: | 0.271 |
Eye Corrosion: | 0.006 | Eye Irritation: | 0.055 |
Respiratory Toxicity: | 0.402 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
D03ZJE | 0.313 | ||||||
D0I4DQ | 0.307 | ||||||
D0XN8C | 0.296 | ||||||
D00CTS | 0.290 | ||||||
D0AY9Q | 0.275 | ||||||
D0V0IX | 0.275 | ||||||
D09SRR | 0.274 | ||||||
D06FEA | 0.264 | ||||||
D09ANG | 0.263 | ||||||
D0N3NO | 0.263 |