NPs Basic Information
|
Name |
(-)-(2R,3R,4aR)-altenuene-3-acetoxy ester
|
| Molecular Formula | C17H18O7 | |
| IUPAC Name* |
[(2R,3R,4aR)-2,7-dihydroxy-9-methoxy-4a-methyl-6-oxo-3,4-dihydro-2H-benzo[c]chromen-3-yl] acetate
|
|
| SMILES |
CC(=O)O[C@@H]1C[C@@]2(C(=C[C@H]1O)C3=C(C(=CC(=C3)OC)O)C(=O)O2)C
|
|
| InChI |
InChI=1S/C17H18O7/c1-8(18)23-14-7-17(2)11(6-12(14)19)10-4-9(22-3)5-13(20)15(10)16(21)24-17/h4-6,12,14,19-20H,7H2,1-3H3/t12-,14-,17-/m1/s1
|
|
| InChIKey |
NRCQFDXVYVENDF-SUYBPPKGSA-N
|
|
| Synonyms |
(-)-(2R,3R,4aR)-altenuene-3-acetoxy ester
|
|
| CAS | NA | |
| PubChem CID | 139588595 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 334.3 | ALogp: | 1.3 |
| HBD: | 2 | HBA: | 7 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 102.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 24 | QED Weighted: | 0.797 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.776 | MDCK Permeability: | 0.00003210 |
| Pgp-inhibitor: | 0.012 | Pgp-substrate: | 0.013 |
| Human Intestinal Absorption (HIA): | 0.162 | 20% Bioavailability (F20%): | 0.106 |
| 30% Bioavailability (F30%): | 0.692 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.735 | Plasma Protein Binding (PPB): | 82.85% |
| Volume Distribution (VD): | 0.614 | Fu: | 24.27% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.443 | CYP1A2-substrate: | 0.411 |
| CYP2C19-inhibitor: | 0.206 | CYP2C19-substrate: | 0.51 |
| CYP2C9-inhibitor: | 0.267 | CYP2C9-substrate: | 0.88 |
| CYP2D6-inhibitor: | 0.126 | CYP2D6-substrate: | 0.523 |
| CYP3A4-inhibitor: | 0.563 | CYP3A4-substrate: | 0.324 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 6.145 | Half-life (T1/2): | 0.781 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.421 |
| Drug-inuced Liver Injury (DILI): | 0.897 | AMES Toxicity: | 0.037 |
| Rat Oral Acute Toxicity: | 0.492 | Maximum Recommended Daily Dose: | 0.867 |
| Skin Sensitization: | 0.056 | Carcinogencity: | 0.091 |
| Eye Corrosion: | 0.006 | Eye Irritation: | 0.185 |
| Respiratory Toxicity: | 0.131 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003610 |  |
1.000 | D07MGA |  |
0.260 | ||
| ENC003769 |  |
0.806 | D0J5TS |  |
0.255 | ||
| ENC003686 |  |
0.806 | D01XWG |  |
0.254 | ||
| ENC004850 |  |
0.806 | D02DKD |  |
0.239 | ||
| ENC003974 |  |
0.806 | D09DHY |  |
0.239 | ||
| ENC006131 |  |
0.718 | D0C1SF |  |
0.238 | ||
| ENC006132 |  |
0.718 | D0OB1J |  |
0.237 | ||
| ENC005177 |  |
0.718 | D0H0SJ |  |
0.235 | ||
| ENC004851 |  |
0.718 | D0C9XJ |  |
0.230 | ||
| ENC005362 |  |
0.718 | D07VLY |  |
0.230 | ||