|
Name |
Peaurantiogriseol C
|
Molecular Formula | C16H26O3 | |
IUPAC Name* |
1-[(1S,2S,4aR,6S,8aS)-6-hydroxy-1,2,6-trimethyl-2,4a,5,7,8,8a-hexahydronaphthalen-1-yl]-3-hydroxypropan-1-one
|
|
SMILES |
C[C@H]1C=C[C@H]2C[C@@](CC[C@@H]2[C@@]1(C)C(=O)CCO)(C)O
|
|
InChI |
InChI=1S/C16H26O3/c1-11-4-5-12-10-15(2,19)8-6-13(12)16(11,3)14(18)7-9-17/h4-5,11-13,17,19H,6-10H2,1-3H3/t11-,12-,13-,15-,16-/m0/s1
|
|
InChIKey |
LUIMBFWYYYLNKF-IICXDKKESA-N
|
|
Synonyms |
Peaurantiogriseol C
|
|
CAS | NA | |
PubChem CID | 139588090 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 266.38 | ALogp: | 1.5 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 57.5 | Aromatic Rings: | 2 |
Heavy Atoms: | 19 | QED Weighted: | 0.772 |
Caco-2 Permeability: | -4.392 | MDCK Permeability: | 0.00002020 |
Pgp-inhibitor: | 0.749 | Pgp-substrate: | 0.052 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.159 |
Blood-Brain-Barrier Penetration (BBB): | 0.914 | Plasma Protein Binding (PPB): | 16.00% |
Volume Distribution (VD): | 0.685 | Fu: | 55.13% |
CYP1A2-inhibitor: | 0.028 | CYP1A2-substrate: | 0.809 |
CYP2C19-inhibitor: | 0.031 | CYP2C19-substrate: | 0.832 |
CYP2C9-inhibitor: | 0.023 | CYP2C9-substrate: | 0.05 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.055 |
CYP3A4-inhibitor: | 0.809 | CYP3A4-substrate: | 0.52 |
Clearance (CL): | 13.667 | Half-life (T1/2): | 0.859 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.264 |
Drug-inuced Liver Injury (DILI): | 0.041 | AMES Toxicity: | 0.045 |
Rat Oral Acute Toxicity: | 0.121 | Maximum Recommended Daily Dose: | 0.145 |
Skin Sensitization: | 0.651 | Carcinogencity: | 0.7 |
Eye Corrosion: | 0.961 | Eye Irritation: | 0.964 |
Respiratory Toxicity: | 0.933 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003690 | 0.625 | D08PIQ | 0.319 | ||||
ENC003792 | 0.609 | D0D1SG | 0.298 | ||||
ENC003781 | 0.545 | D0V9DZ | 0.292 | ||||
ENC001954 | 0.500 | D0CW1P | 0.286 | ||||
ENC002170 | 0.463 | D07DVK | 0.286 | ||||
ENC005218 | 0.444 | D0IT2G | 0.286 | ||||
ENC003603 | 0.438 | D0IL7L | 0.284 | ||||
ENC003119 | 0.346 | D0KR5B | 0.284 | ||||
ENC003713 | 0.340 | D0P0HT | 0.281 | ||||
ENC003292 | 0.321 | D0R7JT | 0.278 |