|
Name |
Thielavin S
|
Molecular Formula | C25H24O8 | |
IUPAC Name* |
(3-hydroxy-2,5-dimethylphenyl) 4-(2,4-dihydroxy-6-methylbenzoyl)oxy-2-hydroxy-3,6-dimethylbenzoate
|
|
SMILES |
CC1=CC(=C(C(=C1)OC(=O)C2=C(C(=C(C=C2C)OC(=O)C3=C(C=C(C=C3C)O)O)C)O)C)O
|
|
InChI |
InChI=1S/C25H24O8/c1-11-6-17(27)14(4)19(7-11)32-25(31)22-13(3)9-20(15(5)23(22)29)33-24(30)21-12(2)8-16(26)10-18(21)28/h6-10,26-29H,1-5H3
|
|
InChIKey |
QUVZPCQMCZMGDL-UHFFFAOYSA-N
|
|
Synonyms |
Thielavin S
|
|
CAS | NA | |
PubChem CID | 139587765 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 452.5 | ALogp: | 6.2 |
HBD: | 4 | HBA: | 8 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 134.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 33 | QED Weighted: | 0.321 |
Caco-2 Permeability: | -5.702 | MDCK Permeability: | 0.00001530 |
Pgp-inhibitor: | 0.24 | Pgp-substrate: | 0.143 |
Human Intestinal Absorption (HIA): | 0.081 | 20% Bioavailability (F20%): | 0.952 |
30% Bioavailability (F30%): | 0.731 |
Blood-Brain-Barrier Penetration (BBB): | 0.004 | Plasma Protein Binding (PPB): | 100.84% |
Volume Distribution (VD): | 0.407 | Fu: | 0.61% |
CYP1A2-inhibitor: | 0.748 | CYP1A2-substrate: | 0.873 |
CYP2C19-inhibitor: | 0.743 | CYP2C19-substrate: | 0.058 |
CYP2C9-inhibitor: | 0.683 | CYP2C9-substrate: | 0.625 |
CYP2D6-inhibitor: | 0.182 | CYP2D6-substrate: | 0.444 |
CYP3A4-inhibitor: | 0.207 | CYP3A4-substrate: | 0.139 |
Clearance (CL): | 11.649 | Half-life (T1/2): | 0.827 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.003 |
Drug-inuced Liver Injury (DILI): | 0.479 | AMES Toxicity: | 0.059 |
Rat Oral Acute Toxicity: | 0.232 | Maximum Recommended Daily Dose: | 0.961 |
Skin Sensitization: | 0.947 | Carcinogencity: | 0.031 |
Eye Corrosion: | 0.009 | Eye Irritation: | 0.964 |
Respiratory Toxicity: | 0.267 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003695 | 0.780 | D0K8KX | 0.287 | ||||
ENC003651 | 0.651 | D04AIT | 0.281 | ||||
ENC003748 | 0.636 | D06RUL | 0.264 | ||||
ENC003680 | 0.622 | D07MGA | 0.263 | ||||
ENC003732 | 0.604 | D0WY9N | 0.257 | ||||
ENC005301 | 0.554 | D06GCK | 0.256 | ||||
ENC002078 | 0.532 | D0AZ8C | 0.240 | ||||
ENC004140 | 0.528 | D0N1FS | 0.238 | ||||
ENC003724 | 0.500 | D00PEH | 0.233 | ||||
ENC004713 | 0.479 | D0Q0PR | 0.232 |