|
Name |
Lasiodipline D
|
Molecular Formula | C15H15N3O3S2 | |
IUPAC Name* |
(1S,4R,5S)-5-hydroxy-4-(1H-indol-3-yl)-1,8-dimethyl-2,3-dithia-6,8-diazabicyclo[3.2.2]nonane-7,9-dione
|
|
SMILES |
C[C@@]12C(=O)N[C@@]([C@H](SS1)C3=CNC4=CC=CC=C43)(C(=O)N2C)O
|
|
InChI |
InChI=1S/C15H15N3O3S2/c1-14-12(19)17-15(21,13(20)18(14)2)11(22-23-14)9-7-16-10-6-4-3-5-8(9)10/h3-7,11,16,21H,1-2H3,(H,17,19)/t11-,14+,15-/m1/s1
|
|
InChIKey |
JXDYINKSODYJMC-BYCMXARLSA-N
|
|
Synonyms |
Lasiodipline D
|
|
CAS | NA | |
PubChem CID | 139587543 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 349.4 | ALogp: | 0.6 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 136.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 23 | QED Weighted: | 0.687 |
Caco-2 Permeability: | -4.821 | MDCK Permeability: | 0.00000903 |
Pgp-inhibitor: | 0.019 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.223 |
Blood-Brain-Barrier Penetration (BBB): | 0.991 | Plasma Protein Binding (PPB): | 77.10% |
Volume Distribution (VD): | 1.431 | Fu: | 30.21% |
CYP1A2-inhibitor: | 0.226 | CYP1A2-substrate: | 0.731 |
CYP2C19-inhibitor: | 0.877 | CYP2C19-substrate: | 0.837 |
CYP2C9-inhibitor: | 0.809 | CYP2C9-substrate: | 0.754 |
CYP2D6-inhibitor: | 0.059 | CYP2D6-substrate: | 0.109 |
CYP3A4-inhibitor: | 0.651 | CYP3A4-substrate: | 0.939 |
Clearance (CL): | 9.754 | Half-life (T1/2): | 0.265 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.13 |
Drug-inuced Liver Injury (DILI): | 0.972 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.368 | Maximum Recommended Daily Dose: | 0.231 |
Skin Sensitization: | 0.358 | Carcinogencity: | 0.199 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.581 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004869 | 0.477 | D07RGW | 0.317 | ||||
ENC004868 | 0.422 | D08UMH | 0.314 | ||||
ENC003530 | 0.417 | D08EOD | 0.313 | ||||
ENC004345 | 0.409 | D05EJG | 0.309 | ||||
ENC005917 | 0.409 | D0K0KH | 0.289 | ||||
ENC005916 | 0.409 | D0W7WC | 0.279 | ||||
ENC004342 | 0.409 | D00YLW | 0.276 | ||||
ENC004343 | 0.409 | D0Y7RW | 0.276 | ||||
ENC004344 | 0.409 | D06BYV | 0.272 | ||||
ENC005918 | 0.407 | D0U5RT | 0.267 |