|
Name |
4-[5-(Hydroxymethyl)-2-furanyl]-1,2,3,5-tetrahydrobenzo[b][1,6]naphthyridine-1,3-dione
|
Molecular Formula | C17H12N2O4 | |
IUPAC Name* |
1-hydroxy-4-[5-(hydroxymethyl)furan-2-yl]-2H-benzo[b][1,6]naphthyridin-3-one
|
|
SMILES |
C1=CC2=CC3=C(NC(=O)C(=C3N=C2C=C1)C4=CC=C(O4)CO)O
|
|
InChI |
InChI=1S/C17H12N2O4/c20-8-10-5-6-13(23-10)14-15-11(16(21)19-17(14)22)7-9-3-1-2-4-12(9)18-15/h1-7,20H,8H2,(H2,19,21,22)
|
|
InChIKey |
ANWPIKJRRHBPGC-UHFFFAOYSA-N
|
|
Synonyms |
Chaetominedione; 4-[5-(Hydroxymethyl)-2-furanyl]-1,2,3,5-tetrahydrobenzo[b][1,6]naphthyridine-1,3-dione
|
|
CAS | NA | |
PubChem CID | 135875885 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 308.29 | ALogp: | 0.2 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 95.1 | Aromatic Rings: | 4 |
Heavy Atoms: | 23 | QED Weighted: | 0.493 |
Caco-2 Permeability: | -4.895 | MDCK Permeability: | 0.00000814 |
Pgp-inhibitor: | 0.007 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.99 |
30% Bioavailability (F30%): | 0.998 |
Blood-Brain-Barrier Penetration (BBB): | 0.041 | Plasma Protein Binding (PPB): | 97.37% |
Volume Distribution (VD): | 0.431 | Fu: | 1.88% |
CYP1A2-inhibitor: | 0.975 | CYP1A2-substrate: | 0.143 |
CYP2C19-inhibitor: | 0.151 | CYP2C19-substrate: | 0.058 |
CYP2C9-inhibitor: | 0.502 | CYP2C9-substrate: | 0.439 |
CYP2D6-inhibitor: | 0.557 | CYP2D6-substrate: | 0.483 |
CYP3A4-inhibitor: | 0.512 | CYP3A4-substrate: | 0.165 |
Clearance (CL): | 3.718 | Half-life (T1/2): | 0.605 |
hERG Blockers: | 0.039 | Human Hepatotoxicity (H-HT): | 0.695 |
Drug-inuced Liver Injury (DILI): | 0.988 | AMES Toxicity: | 0.073 |
Rat Oral Acute Toxicity: | 0.195 | Maximum Recommended Daily Dose: | 0.122 |
Skin Sensitization: | 0.062 | Carcinogencity: | 0.639 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.02 |
Respiratory Toxicity: | 0.729 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003516 | 0.391 | D02TJS | 0.317 | ||||
ENC000858 | 0.379 | D0QV5T | 0.299 | ||||
ENC003571 | 0.375 | D06TJJ | 0.290 | ||||
ENC005446 | 0.352 | D0E0OG | 0.289 | ||||
ENC005445 | 0.352 | D04VKS | 0.284 | ||||
ENC003390 | 0.337 | D0E3OF | 0.284 | ||||
ENC000566 | 0.333 | D0Z3DY | 0.283 | ||||
ENC004931 | 0.330 | D09LDR | 0.281 | ||||
ENC000714 | 0.329 | D0Z5OV | 0.281 | ||||
ENC003736 | 0.315 | D0O6IZ | 0.281 |