|
Name |
(1'R,4'S,4'aR,5'S,8'aS)-spiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,8'-4,4a,5,6,7,8a-hexahydro-1H-naphthalene]-1',4',5'-triol
|
Molecular Formula | C20H20O5 | |
IUPAC Name* |
(1'R,4'S,4'aR,5'S,8'aS)-spiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,8'-4,4a,5,6,7,8a-hexahydro-1H-naphthalene]-1',4',5'-triol
|
|
SMILES |
C1CC2([C@@H]3[C@@H](C=C[C@@H]([C@H]3[C@H]1O)O)O)OC4=CC=CC5=C4C(=CC=C5)O2
|
|
InChI |
InChI=1S/C20H20O5/c21-12-7-8-14(23)19-18(12)13(22)9-10-20(19)24-15-5-1-3-11-4-2-6-16(25-20)17(11)15/h1-8,12-14,18-19,21-23H,9-10H2/t12-,13-,14+,18-,19+/m0/s1
|
|
InChIKey |
MTHUNPKHURTKGB-ZXGKTVMQSA-N
|
|
Synonyms |
Palmarumycin CR1; J3.511.181F
|
|
CAS | NA | |
PubChem CID | 132603694 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 340.4 | ALogp: | 2.2 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 79.2 | Aromatic Rings: | 5 |
Heavy Atoms: | 25 | QED Weighted: | 0.643 |
Caco-2 Permeability: | -5.05 | MDCK Permeability: | 0.00001910 |
Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.223 |
Human Intestinal Absorption (HIA): | 0.022 | 20% Bioavailability (F20%): | 0.012 |
30% Bioavailability (F30%): | 0.486 |
Blood-Brain-Barrier Penetration (BBB): | 0.953 | Plasma Protein Binding (PPB): | 94.93% |
Volume Distribution (VD): | 0.889 | Fu: | 5.36% |
CYP1A2-inhibitor: | 0.293 | CYP1A2-substrate: | 0.125 |
CYP2C19-inhibitor: | 0.191 | CYP2C19-substrate: | 0.199 |
CYP2C9-inhibitor: | 0.339 | CYP2C9-substrate: | 0.925 |
CYP2D6-inhibitor: | 0.088 | CYP2D6-substrate: | 0.219 |
CYP3A4-inhibitor: | 0.187 | CYP3A4-substrate: | 0.154 |
Clearance (CL): | 11.265 | Half-life (T1/2): | 0.568 |
hERG Blockers: | 0.125 | Human Hepatotoxicity (H-HT): | 0.203 |
Drug-inuced Liver Injury (DILI): | 0.067 | AMES Toxicity: | 0.061 |
Rat Oral Acute Toxicity: | 0.499 | Maximum Recommended Daily Dose: | 0.041 |
Skin Sensitization: | 0.239 | Carcinogencity: | 0.192 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.027 |
Respiratory Toxicity: | 0.943 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003418 | 0.629 | D0WE3O | 0.245 | ||||
ENC003417 | 0.582 | D06ALD | 0.240 | ||||
ENC003411 | 0.547 | D00JRA | 0.238 | ||||
ENC003416 | 0.532 | D0O6IZ | 0.237 | ||||
ENC003287 | 0.532 | D08CCE | 0.234 | ||||
ENC003288 | 0.532 | D03DIG | 0.227 | ||||
ENC003290 | 0.527 | D0Z1FX | 0.224 | ||||
ENC005581 | 0.511 | D06TJJ | 0.220 | ||||
ENC003642 | 0.511 | D01TNW | 0.220 | ||||
ENC002185 | 0.500 | D0Q3VE | 0.219 |