|
Name |
Preaustinoid A2
|
Molecular Formula | C26H34O7 | |
IUPAC Name* |
methyl (1R,2S,5S,11S,12S,14R,16S)-16-hydroxy-2,6,6,11,14,16-hexamethyl-18-methylidene-8,15,17-trioxo-7-oxatetracyclo[12.3.1.02,12.05,11]octadec-9-ene-1-carboxylate
|
|
SMILES |
C[C@]12CC[C@H]3[C@]([C@@H]1C[C@@]4(C(=C)[C@]2(C(=O)[C@@](C4=O)(C)O)C(=O)OC)C)(C=CC(=O)OC3(C)C)C
|
|
InChI |
InChI=1S/C26H34O7/c1-14-23(5)13-16-22(4)11-10-17(27)33-21(2,3)15(22)9-12-24(16,6)26(14,20(30)32-8)19(29)25(7,31)18(23)28/h10-11,15-16,31H,1,9,12-13H2,2-8H3/t15-,16+,22-,23-,24+,25+,26+/m1/s1
|
|
InChIKey |
SGTJQTPUMKGFFZ-RFMSQVAGSA-N
|
|
Synonyms |
Preaustinoid A2; CHEMBL4519119; CHEBI:156343; 8T0
|
|
CAS | NA | |
PubChem CID | 132274399 | |
ChEMBL ID | CHEMBL4519119 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 458.5 | ALogp: | 3.4 |
HBD: | 1 | HBA: | 7 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 107.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 33 | QED Weighted: | 0.362 |
Caco-2 Permeability: | -5.363 | MDCK Permeability: | 0.00003330 |
Pgp-inhibitor: | 0.875 | Pgp-substrate: | 0.129 |
Human Intestinal Absorption (HIA): | 0.091 | 20% Bioavailability (F20%): | 0.96 |
30% Bioavailability (F30%): | 0.825 |
Blood-Brain-Barrier Penetration (BBB): | 0.992 | Plasma Protein Binding (PPB): | 68.31% |
Volume Distribution (VD): | 0.504 | Fu: | 33.15% |
CYP1A2-inhibitor: | 0.003 | CYP1A2-substrate: | 0.978 |
CYP2C19-inhibitor: | 0.103 | CYP2C19-substrate: | 0.773 |
CYP2C9-inhibitor: | 0.039 | CYP2C9-substrate: | 0.024 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.009 |
CYP3A4-inhibitor: | 0.936 | CYP3A4-substrate: | 0.951 |
Clearance (CL): | 2.627 | Half-life (T1/2): | 0.249 |
hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.58 |
Drug-inuced Liver Injury (DILI): | 0.763 | AMES Toxicity: | 0.115 |
Rat Oral Acute Toxicity: | 0.077 | Maximum Recommended Daily Dose: | 0.636 |
Skin Sensitization: | 0.187 | Carcinogencity: | 0.919 |
Eye Corrosion: | 0.899 | Eye Irritation: | 0.342 |
Respiratory Toxicity: | 0.982 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005629 | 0.411 | D0P0HT | 0.254 | ||||
ENC005963 | 0.406 | D0Q4SD | 0.250 | ||||
ENC006004 | 0.403 | D03ZZK | 0.250 | ||||
ENC005188 | 0.402 | D0H2MO | 0.248 | ||||
ENC005318 | 0.402 | D0IL7L | 0.246 | ||||
ENC005250 | 0.398 | D02JNM | 0.244 | ||||
ENC002162 | 0.392 | D0I5DS | 0.242 | ||||
ENC005964 | 0.389 | D0D2TN | 0.242 | ||||
ENC005189 | 0.388 | D04GJN | 0.242 | ||||
ENC005317 | 0.388 | D02QJH | 0.237 |