|
Name |
2-[[(1R,4aR,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-3-hydroxy-5-(hydroxymethyl)cyclohexa-2,5-diene-1,4-dione
|
Molecular Formula | C22H30O4 | |
IUPAC Name* |
2-[[(1R,4aR,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-3-hydroxy-5-(hydroxymethyl)cyclohexa-2,5-diene-1,4-dione
|
|
SMILES |
C[C@@]12CCCC([C@H]1CCC(=C)[C@H]2CC3=C(C(=O)C(=CC3=O)CO)O)(C)C
|
|
InChI |
InChI=1S/C22H30O4/c1-13-6-7-18-21(2,3)8-5-9-22(18,4)16(13)11-15-17(24)10-14(12-23)19(25)20(15)26/h10,16,18,23,26H,1,5-9,11-12H2,2-4H3/t16-,18-,22+/m1/s1
|
|
InChIKey |
KNEPVLLGXUSFJS-CDMIOBSGSA-N
|
|
Synonyms |
tauranin; 6752-85-8
|
|
CAS | NA | |
PubChem CID | 101967117 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 358.5 | ALogp: | 4.4 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 74.6 | Aromatic Rings: | 3 |
Heavy Atoms: | 26 | QED Weighted: | 0.568 |
Caco-2 Permeability: | -4.876 | MDCK Permeability: | 0.00001740 |
Pgp-inhibitor: | 0.408 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.992 |
30% Bioavailability (F30%): | 0.89 |
Blood-Brain-Barrier Penetration (BBB): | 0.079 | Plasma Protein Binding (PPB): | 99.06% |
Volume Distribution (VD): | 3.64 | Fu: | 1.28% |
CYP1A2-inhibitor: | 0.191 | CYP1A2-substrate: | 0.794 |
CYP2C19-inhibitor: | 0.403 | CYP2C19-substrate: | 0.367 |
CYP2C9-inhibitor: | 0.41 | CYP2C9-substrate: | 0.949 |
CYP2D6-inhibitor: | 0.373 | CYP2D6-substrate: | 0.477 |
CYP3A4-inhibitor: | 0.165 | CYP3A4-substrate: | 0.146 |
Clearance (CL): | 3.874 | Half-life (T1/2): | 0.698 |
hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.038 |
Drug-inuced Liver Injury (DILI): | 0.032 | AMES Toxicity: | 0.113 |
Rat Oral Acute Toxicity: | 0.116 | Maximum Recommended Daily Dose: | 0.335 |
Skin Sensitization: | 0.92 | Carcinogencity: | 0.037 |
Eye Corrosion: | 0.025 | Eye Irritation: | 0.918 |
Respiratory Toxicity: | 0.87 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002494 | 0.810 | D04VIS | 0.353 | ||||
ENC002490 | 0.753 | D0S0NK | 0.344 | ||||
ENC002493 | 0.753 | D01CKY | 0.275 | ||||
ENC000956 | 0.548 | D0D2VS | 0.272 | ||||
ENC002492 | 0.511 | D0IX6I | 0.270 | ||||
ENC002141 | 0.459 | D0G8BV | 0.264 | ||||
ENC002491 | 0.439 | D0IL7L | 0.259 | ||||
ENC003143 | 0.414 | D0F2AK | 0.257 | ||||
ENC005585 | 0.396 | D04ATM | 0.252 | ||||
ENC001844 | 0.396 | D0L2LS | 0.250 |