|
Name |
Setosol
|
Molecular Formula | C15H16O5 | |
IUPAC Name* |
4-methoxy-2,8-dimethyl-1-benzoxonine-6,10,11-triol
|
|
SMILES |
CC1=CC(=C(C2=C1C=C(C=C(C=C(O2)C)OC)O)O)O
|
|
InChI |
InChI=1S/C15H16O5/c1-8-4-13(17)14(18)15-12(8)7-10(16)6-11(19-3)5-9(2)20-15/h4-7,16-18H,1-3H3
|
|
InChIKey |
MVWNYMTYKBWPHR-UHFFFAOYSA-N
|
|
Synonyms |
Setosol
|
|
CAS | NA | |
PubChem CID | 101663798 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 276.28 | ALogp: | 3.3 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 83.1 | Aromatic Rings: | 2 |
Heavy Atoms: | 20 | QED Weighted: | 0.684 |
Caco-2 Permeability: | -4.966 | MDCK Permeability: | 0.00001030 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.95 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.721 |
30% Bioavailability (F30%): | 0.569 |
Blood-Brain-Barrier Penetration (BBB): | 0.011 | Plasma Protein Binding (PPB): | 97.45% |
Volume Distribution (VD): | 0.579 | Fu: | 5.20% |
CYP1A2-inhibitor: | 0.974 | CYP1A2-substrate: | 0.941 |
CYP2C19-inhibitor: | 0.329 | CYP2C19-substrate: | 0.119 |
CYP2C9-inhibitor: | 0.458 | CYP2C9-substrate: | 0.918 |
CYP2D6-inhibitor: | 0.715 | CYP2D6-substrate: | 0.899 |
CYP3A4-inhibitor: | 0.255 | CYP3A4-substrate: | 0.268 |
Clearance (CL): | 13.63 | Half-life (T1/2): | 0.903 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.095 |
Drug-inuced Liver Injury (DILI): | 0.943 | AMES Toxicity: | 0.154 |
Rat Oral Acute Toxicity: | 0.245 | Maximum Recommended Daily Dose: | 0.936 |
Skin Sensitization: | 0.916 | Carcinogencity: | 0.068 |
Eye Corrosion: | 0.013 | Eye Irritation: | 0.92 |
Respiratory Toxicity: | 0.395 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002516 | 0.542 | D0FA2O | 0.403 | ||||
ENC005122 | 0.521 | D07MGA | 0.337 | ||||
ENC005647 | 0.521 | D0G4KG | 0.321 | ||||
ENC005123 | 0.500 | D04AIT | 0.318 | ||||
ENC005808 | 0.493 | D0K8KX | 0.310 | ||||
ENC005191 | 0.493 | D06GCK | 0.309 | ||||
ENC004846 | 0.493 | D07EXH | 0.279 | ||||
ENC001653 | 0.493 | D04UTT | 0.257 | ||||
ENC000979 | 0.493 | D01XNB | 0.247 | ||||
ENC003724 | 0.486 | D0C6DT | 0.247 |