|
Name |
Tris(tert-butyldimethylsilyloxy)arsane
|
Molecular Formula | C18H45AsO3Si3 | |
IUPAC Name* |
tris[tert-butyl(dimethyl)silyl] arsorite
|
|
SMILES |
CC(C)(C)[Si](C)(C)O[As](O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C
|
|
InChI |
InChI=1S/C18H45AsO3Si3/c1-16(2,3)23(10,11)20-19(21-24(12,13)17(4,5)6)22-25(14,15)18(7,8)9/h1-15H3
|
|
InChIKey |
USFSDFMFEDELDX-UHFFFAOYSA-N
|
|
Synonyms |
tris-t-butyldimethylsilyloxy-arsane; Tris(tert-butyldimethylsilyloxy)arsane; Arsenous acid, tris(tert-butyldimethylsilyl) ester
|
|
CAS | NA | |
PubChem CID | 91733954 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 468.7 | ALogp: | 7.0 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 27.7 | Aromatic Rings: | 0 |
Heavy Atoms: | 25 | QED Weighted: | 0.394 |
Caco-2 Permeability: | -5.231 | MDCK Permeability: | 0.00002090 |
Pgp-inhibitor: | 0.889 | Pgp-substrate: | 0.033 |
Human Intestinal Absorption (HIA): | 0.705 | 20% Bioavailability (F20%): | 0.262 |
30% Bioavailability (F30%): | 0.039 |
Blood-Brain-Barrier Penetration (BBB): | 0.01 | Plasma Protein Binding (PPB): | 104.52% |
Volume Distribution (VD): | 3.34 | Fu: | 1.19% |
CYP1A2-inhibitor: | 0.176 | CYP1A2-substrate: | 0.936 |
CYP2C19-inhibitor: | 0.737 | CYP2C19-substrate: | 0.967 |
CYP2C9-inhibitor: | 0.548 | CYP2C9-substrate: | 0.885 |
CYP2D6-inhibitor: | 0.27 | CYP2D6-substrate: | 0.91 |
CYP3A4-inhibitor: | 0.686 | CYP3A4-substrate: | 0.242 |
Clearance (CL): | 3.896 | Half-life (T1/2): | 0.725 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.007 |
Drug-inuced Liver Injury (DILI): | 0.038 | AMES Toxicity: | 0.033 |
Rat Oral Acute Toxicity: | 0.019 | Maximum Recommended Daily Dose: | 0.038 |
Skin Sensitization: | 0.319 | Carcinogencity: | 0.08 |
Eye Corrosion: | 1 | Eye Irritation: | 0.996 |
Respiratory Toxicity: | 0.91 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000530 | 0.276 | D0H2DQ | 0.211 | ||||
ENC000562 | 0.274 | D01JFT | 0.157 | ||||
ENC000373 | 0.260 | D0ML1F | 0.126 | ||||
ENC001785 | 0.258 | D0V3YT | 0.114 | ||||
ENC001784 | 0.257 | D07XYV | 0.113 | ||||
ENC001783 | 0.245 | D0W7WC | 0.113 | ||||
ENC001271 | 0.241 | D00NJL | 0.107 | ||||
ENC001404 | 0.239 | D07IQS | 0.099 | ||||
ENC001122 | 0.226 | D0Z1ZM | 0.095 | ||||
ENC001175 | 0.225 | D03HJK | 0.095 |