|
Name |
7,19-dihydroxy-5-(2-hydroxypropyl)-21-[(2R)-2-hydroxypropyl]-6,20-dimethoxy-12,14-dioxahexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1,3(8),4,6,10,15,18(23),19,21-nonaene-9,17-dione
|
Molecular Formula | C29H26O10 | |
IUPAC Name* |
7,19-dihydroxy-5-(2-hydroxypropyl)-21-[(2R)-2-hydroxypropyl]-6,20-dimethoxy-12,14-dioxahexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1,3(8),4,6,10,15,18(23),19,21-nonaene-9,17-dione
|
|
SMILES |
C[C@H](CC1=C2C3=C(C(=C(C4=C3C5=C6C2=C(C(=O)C=C6OCOC5=CC4=O)C(=C1OC)O)O)OC)CC(C)O)O
|
|
InChI |
InChI=1S/C29H26O10/c1-10(30)5-12-18-19-13(6-11(2)31)29(37-4)27(35)21-15(33)8-17-23(25(19)21)22-16(38-9-39-17)7-14(32)20(24(18)22)26(34)28(12)36-3/h7-8,10-11,30-31,34-35H,5-6,9H2,1-4H3/t10-,11?/m1/s1
|
|
InChIKey |
MXLWQNCWIIZUQT-NFJWQWPMSA-N
|
|
Synonyms |
CERCOSPORIN; 35082-49-6
|
|
CAS | NA | |
PubChem CID | 90471707 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 534.5 | ALogp: | 4.0 |
HBD: | 4 | HBA: | 10 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 152.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 39 | QED Weighted: | 0.187 |
Caco-2 Permeability: | -5.218 | MDCK Permeability: | 0.00000859 |
Pgp-inhibitor: | 0.302 | Pgp-substrate: | 0.677 |
Human Intestinal Absorption (HIA): | 0.202 | 20% Bioavailability (F20%): | 0 |
30% Bioavailability (F30%): | 0.018 |
Blood-Brain-Barrier Penetration (BBB): | 0.009 | Plasma Protein Binding (PPB): | 80.33% |
Volume Distribution (VD): | 1.089 | Fu: | 20.92% |
CYP1A2-inhibitor: | 0.399 | CYP1A2-substrate: | 0.694 |
CYP2C19-inhibitor: | 0.151 | CYP2C19-substrate: | 0.128 |
CYP2C9-inhibitor: | 0.702 | CYP2C9-substrate: | 0.914 |
CYP2D6-inhibitor: | 0.063 | CYP2D6-substrate: | 0.186 |
CYP3A4-inhibitor: | 0.088 | CYP3A4-substrate: | 0.064 |
Clearance (CL): | 1.187 | Half-life (T1/2): | 0.164 |
hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.064 |
Drug-inuced Liver Injury (DILI): | 0.867 | AMES Toxicity: | 0.327 |
Rat Oral Acute Toxicity: | 0.056 | Maximum Recommended Daily Dose: | 0.496 |
Skin Sensitization: | 0.309 | Carcinogencity: | 0.267 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.401 |
Respiratory Toxicity: | 0.078 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001118 | 0.503 | D06GCK | 0.266 | ||||
ENC001117 | 0.463 | D0D4HN | 0.247 | ||||
ENC004029 | 0.443 | D04TDQ | 0.247 | ||||
ENC001454 | 0.439 | D0L1JW | 0.247 | ||||
ENC003190 | 0.424 | D0G4KG | 0.240 | ||||
ENC000922 | 0.333 | D02FCQ | 0.239 | ||||
ENC002884 | 0.329 | D03RTK | 0.234 | ||||
ENC003154 | 0.327 | D0W8WB | 0.233 | ||||
ENC000912 | 0.325 | D0WY9N | 0.226 | ||||
ENC003507 | 0.325 | D0V6OA | 0.221 |