|
Name |
(-)-Sambutoxin
|
Molecular Formula | C28H39NO4 | |
IUPAC Name* |
3-[6-(4,6-dimethyloct-2-en-2-yl)-5-methyloxan-2-yl]-4-hydroxy-5-(4-hydroxyphenyl)-1-methylpyridin-2-one
|
|
SMILES |
CCC(C)CC(C)C=C(C)C1C(CCC(O1)C2=C(C(=CN(C2=O)C)C3=CC=C(C=C3)O)O)C
|
|
InChI |
InChI=1S/C28H39NO4/c1-7-17(2)14-18(3)15-20(5)27-19(4)8-13-24(33-27)25-26(31)23(16-29(6)28(25)32)21-9-11-22(30)12-10-21/h9-12,15-19,24,27,30-31H,7-8,13-14H2,1-6H3
|
|
InChIKey |
FVYDVAOTXPELMH-UHFFFAOYSA-N
|
|
Synonyms |
Sambutoxin; (-)-sambutoxin; 160047-56-3; B0005-168457
|
|
CAS | NA | |
PubChem CID | 76181157 | |
ChEMBL ID | CHEMBL480870 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 453.6 | ALogp: | 5.7 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 70.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 33 | QED Weighted: | 0.481 |
Caco-2 Permeability: | -4.638 | MDCK Permeability: | 0.00001430 |
Pgp-inhibitor: | 0.631 | Pgp-substrate: | 0.029 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.566 |
30% Bioavailability (F30%): | 0.483 |
Blood-Brain-Barrier Penetration (BBB): | 0.131 | Plasma Protein Binding (PPB): | 98.74% |
Volume Distribution (VD): | 1.219 | Fu: | 0.84% |
CYP1A2-inhibitor: | 0.155 | CYP1A2-substrate: | 0.928 |
CYP2C19-inhibitor: | 0.808 | CYP2C19-substrate: | 0.867 |
CYP2C9-inhibitor: | 0.446 | CYP2C9-substrate: | 0.965 |
CYP2D6-inhibitor: | 0.047 | CYP2D6-substrate: | 0.68 |
CYP3A4-inhibitor: | 0.334 | CYP3A4-substrate: | 0.625 |
Clearance (CL): | 9.163 | Half-life (T1/2): | 0.043 |
hERG Blockers: | 0.037 | Human Hepatotoxicity (H-HT): | 0.784 |
Drug-inuced Liver Injury (DILI): | 0.553 | AMES Toxicity: | 0.132 |
Rat Oral Acute Toxicity: | 0.544 | Maximum Recommended Daily Dose: | 0.254 |
Skin Sensitization: | 0.19 | Carcinogencity: | 0.057 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.016 |
Respiratory Toxicity: | 0.617 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003476 | 1.000 | D0O6GC | 0.244 | ||||
ENC004958 | 0.731 | D0QC3M | 0.244 | ||||
ENC002822 | 0.586 | D02LTL | 0.240 | ||||
ENC002361 | 0.538 | D08GHB | 0.236 | ||||
ENC005616 | 0.361 | D0Z1WA | 0.235 | ||||
ENC004038 | 0.327 | D0H6QU | 0.235 | ||||
ENC002814 | 0.326 | D03KIA | 0.234 | ||||
ENC003249 | 0.302 | D0I0DL | 0.233 | ||||
ENC004319 | 0.292 | D04XEG | 0.228 | ||||
ENC005323 | 0.290 | D0JE2E | 0.228 |