|
Name |
Chartarlactam D
|
Molecular Formula | C29H41NO9 | |
IUPAC Name* |
(3R,4aS,7R,8R,8aS)-3-hydroxy-4,4,7,8a-tetramethyl-4'-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-7,8-dihydro-3H-furo[2,3-e]isoindole]-6'-one
|
|
SMILES |
C[C@@H]1CC[C@@H]2[C@@]([C@@]13CC4=C(C=C5C(=C4O3)CNC5=O)O[C@@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)(CC[C@H](C2(C)C)O)C
|
|
InChI |
InChI=1S/C29H41NO9/c1-13-5-6-19-27(2,3)20(32)7-8-28(19,4)29(13)10-15-17(9-14-16(24(15)39-29)11-30-25(14)36)37-26-23(35)22(34)21(33)18(12-31)38-26/h9,13,18-23,26,31-35H,5-8,10-12H2,1-4H3,(H,30,36)/t13-,18-,19+,20-,21-,22+,23-,26+,28+,29-/m1/s1
|
|
InChIKey |
MRDTZTOWXPWUHM-ISWHWHLFSA-N
|
|
Synonyms |
Chartarlactam D; CHEMBL3104980
|
|
CAS | NA | |
PubChem CID | 73891066 | |
ChEMBL ID | CHEMBL3104980 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 547.6 | ALogp: | 1.9 |
HBD: | 6 | HBA: | 9 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 158.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 39 | QED Weighted: | 0.329 |
Caco-2 Permeability: | -6.04 | MDCK Permeability: | 0.00000675 |
Pgp-inhibitor: | 0.016 | Pgp-substrate: | 0.914 |
Human Intestinal Absorption (HIA): | 0.493 | 20% Bioavailability (F20%): | 0.044 |
30% Bioavailability (F30%): | 0.741 |
Blood-Brain-Barrier Penetration (BBB): | 0.091 | Plasma Protein Binding (PPB): | 70.44% |
Volume Distribution (VD): | 0.828 | Fu: | 19.82% |
CYP1A2-inhibitor: | 0.023 | CYP1A2-substrate: | 0.103 |
CYP2C19-inhibitor: | 0.012 | CYP2C19-substrate: | 0.686 |
CYP2C9-inhibitor: | 0.015 | CYP2C9-substrate: | 0.134 |
CYP2D6-inhibitor: | 0.016 | CYP2D6-substrate: | 0.19 |
CYP3A4-inhibitor: | 0.063 | CYP3A4-substrate: | 0.084 |
Clearance (CL): | 2.957 | Half-life (T1/2): | 0.446 |
hERG Blockers: | 0.171 | Human Hepatotoxicity (H-HT): | 0.304 |
Drug-inuced Liver Injury (DILI): | 0.038 | AMES Toxicity: | 0.137 |
Rat Oral Acute Toxicity: | 0.502 | Maximum Recommended Daily Dose: | 0.945 |
Skin Sensitization: | 0.29 | Carcinogencity: | 0.029 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.813 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002673 | 0.643 | D0S0NK | 0.358 | ||||
ENC003020 | 0.643 | D04RYU | 0.339 | ||||
ENC005396 | 0.643 | D0AR3J | 0.311 | ||||
ENC003014 | 0.585 | D0M2QH | 0.303 | ||||
ENC003017 | 0.550 | D06BQU | 0.296 | ||||
ENC003009 | 0.550 | D0I9HF | 0.271 | ||||
ENC001975 | 0.550 | D0T5BC | 0.271 | ||||
ENC003789 | 0.546 | D04MRG | 0.268 | ||||
ENC002996 | 0.546 | D07TGN | 0.266 | ||||
ENC002995 | 0.546 | D09HTS | 0.265 |