|
Name |
spiropreussomerin A
|
Molecular Formula | C20H14O5 | |
IUPAC Name* |
(1'aR,7'R,7'aR)-spiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,2'-7,7a-dihydro-1aH-naphtho[2,3-b]oxirene]-4',7'-diol
|
|
SMILES |
C1=CC2=C3C(=C1)OC4([C@H]5[C@H](O5)[C@@H](C6=C4C=C(C=C6)O)O)OC3=CC=C2
|
|
InChI |
InChI=1S/C20H14O5/c21-11-7-8-12-13(9-11)20(19-18(23-19)17(12)22)24-14-5-1-3-10-4-2-6-15(25-20)16(10)14/h1-9,17-19,21-22H/t17-,18-,19-/m1/s1
|
|
InChIKey |
WVZWQAVVNMSFEX-GUDVDZBRSA-N
|
|
Synonyms |
spiropreussomerin A; CHEMBL1078032
|
|
CAS | NA | |
PubChem CID | 44479484 | |
ChEMBL ID | CHEMBL1078032 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 334.3 | ALogp: | 2.7 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 71.4 | Aromatic Rings: | 6 |
Heavy Atoms: | 25 | QED Weighted: | 0.612 |
Caco-2 Permeability: | -4.974 | MDCK Permeability: | 0.00001810 |
Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.435 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.275 |
30% Bioavailability (F30%): | 0.199 |
Blood-Brain-Barrier Penetration (BBB): | 0.165 | Plasma Protein Binding (PPB): | 97.11% |
Volume Distribution (VD): | 0.671 | Fu: | 1.64% |
CYP1A2-inhibitor: | 0.371 | CYP1A2-substrate: | 0.134 |
CYP2C19-inhibitor: | 0.17 | CYP2C19-substrate: | 0.158 |
CYP2C9-inhibitor: | 0.617 | CYP2C9-substrate: | 0.906 |
CYP2D6-inhibitor: | 0.753 | CYP2D6-substrate: | 0.098 |
CYP3A4-inhibitor: | 0.705 | CYP3A4-substrate: | 0.274 |
Clearance (CL): | 2.448 | Half-life (T1/2): | 0.461 |
hERG Blockers: | 0.147 | Human Hepatotoxicity (H-HT): | 0.947 |
Drug-inuced Liver Injury (DILI): | 0.907 | AMES Toxicity: | 0.975 |
Rat Oral Acute Toxicity: | 0.336 | Maximum Recommended Daily Dose: | 0.496 |
Skin Sensitization: | 0.81 | Carcinogencity: | 0.631 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.666 |
Respiratory Toxicity: | 0.878 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003746 | 0.759 | D06TJJ | 0.355 | ||||
ENC002008 | 0.682 | D0H6TP | 0.258 | ||||
ENC005549 | 0.543 | D09NMD | 0.250 | ||||
ENC005722 | 0.543 | D0AZ8C | 0.248 | ||||
ENC001112 | 0.521 | D04VKS | 0.248 | ||||
ENC005582 | 0.521 | D02NTO | 0.248 | ||||
ENC002038 | 0.515 | D00JRA | 0.248 | ||||
ENC001999 | 0.480 | D08CCE | 0.243 | ||||
ENC005583 | 0.475 | D01JUF | 0.241 | ||||
ENC005524 | 0.475 | D08DFX | 0.240 |