|
Name |
cyclo[OVal-D-N(Me)Phe-OVal-D-N(Me)Phe-OVal-D-N(Me)Phe]
|
Molecular Formula | C45H57N3O9 | |
IUPAC Name* |
(3R,6S,9R,12S,15R,18S)-3,9,15-tribenzyl-4,10,16-trimethyl-6,12,18-tri(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone
|
|
SMILES |
CC(C)[C@H]1C(=O)N([C@@H](C(=O)O[C@H](C(=O)N([C@@H](C(=O)O[C@H](C(=O)N([C@@H](C(=O)O1)CC2=CC=CC=C2)C)C(C)C)CC3=CC=CC=C3)C)C(C)C)CC4=CC=CC=C4)C
|
|
InChI |
InChI=1S/C45H57N3O9/c1-28(2)37-40(49)46(7)35(26-32-21-15-11-16-22-32)44(53)56-39(30(5)6)42(51)48(9)36(27-33-23-17-12-18-24-33)45(54)57-38(29(3)4)41(50)47(8)34(43(52)55-37)25-31-19-13-10-14-20-31/h10-24,28-30,34-39H,25-27H2,1-9H3/t34-,35-,36-,37+,38+,39+/m1/s1
|
|
InChIKey |
GYSCAQFHASJXRS-WXWJZEDASA-N
|
|
Synonyms |
Beauvericin; CHEMBL373872
|
|
CAS | NA | |
PubChem CID | 44419427 | |
ChEMBL ID | CHEMBL373872 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 783.9 | ALogp: | 8.4 |
HBD: | 0 | HBA: | 9 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 140.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 57 | QED Weighted: | 0.209 |
Caco-2 Permeability: | -5.023 | MDCK Permeability: | 0.00011815 |
Pgp-inhibitor: | 1 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.364 |
Blood-Brain-Barrier Penetration (BBB): | 0.004 | Plasma Protein Binding (PPB): | 95.71% |
Volume Distribution (VD): | 1.526 | Fu: | 1.06% |
CYP1A2-inhibitor: | 0.004 | CYP1A2-substrate: | 0.058 |
CYP2C19-inhibitor: | 0.309 | CYP2C19-substrate: | 0.946 |
CYP2C9-inhibitor: | 0.44 | CYP2C9-substrate: | 0.198 |
CYP2D6-inhibitor: | 0.02 | CYP2D6-substrate: | 0.128 |
CYP3A4-inhibitor: | 0.65 | CYP3A4-substrate: | 0.931 |
Clearance (CL): | 5.666 | Half-life (T1/2): | 0.054 |
hERG Blockers: | 0.059 | Human Hepatotoxicity (H-HT): | 0.992 |
Drug-inuced Liver Injury (DILI): | 0.991 | AMES Toxicity: | 0.014 |
Rat Oral Acute Toxicity: | 0.814 | Maximum Recommended Daily Dose: | 0.028 |
Skin Sensitization: | 0.015 | Carcinogencity: | 0.008 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.004 |
Respiratory Toxicity: | 0.004 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001481 | 0.867 | D0U4YG | 0.307 | ||||
ENC003559 | 0.431 | D03DEI | 0.304 | ||||
ENC002857 | 0.430 | D0J7XL | 0.304 | ||||
ENC002129 | 0.429 | D02XIY | 0.300 | ||||
ENC000948 | 0.429 | D07XGH | 0.284 | ||||
ENC004891 | 0.415 | D05MNW | 0.284 | ||||
ENC002483 | 0.371 | D0HF0W | 0.274 | ||||
ENC003692 | 0.358 | D0E0BD | 0.274 | ||||
ENC002484 | 0.354 | D0E2OU | 0.271 | ||||
ENC005449 | 0.348 | D0U5GB | 0.271 |