|
Name |
Chaetomugilin N
|
Molecular Formula | C23H25ClO6 | |
IUPAC Name* |
(6aS,9R,9aS)-5-chloro-3-[(E,3R,4R)-4-hydroxy-3-methylpent-1-enyl]-6a-methyl-9-[(E)-2-methylbut-2-enoyl]-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione
|
|
SMILES |
C/C=C(\C)/C(=O)[C@H]1[C@H]2C3=COC(=CC3=C(C(=O)[C@]2(OC1=O)C)Cl)/C=C/[C@@H](C)[C@@H](C)O
|
|
InChI |
InChI=1S/C23H25ClO6/c1-6-11(2)20(26)17-18-16-10-29-14(8-7-12(3)13(4)25)9-15(16)19(24)21(27)23(18,5)30-22(17)28/h6-10,12-13,17-18,25H,1-5H3/b8-7+,11-6+/t12-,13-,17-,18-,23+/m1/s1
|
|
InChIKey |
MGBUHXLTCIVHLN-MHSGSDPZSA-N
|
|
Synonyms |
Chaetomugilin N
|
|
CAS | NA | |
PubChem CID | 44250027 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 432.9 | ALogp: | 2.9 |
HBD: | 1 | HBA: | 6 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 89.9 | Aromatic Rings: | 3 |
Heavy Atoms: | 30 | QED Weighted: | 0.397 |
Caco-2 Permeability: | -4.638 | MDCK Permeability: | 0.00001580 |
Pgp-inhibitor: | 0.014 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.686 |
30% Bioavailability (F30%): | 0.259 |
Blood-Brain-Barrier Penetration (BBB): | 0.833 | Plasma Protein Binding (PPB): | 74.99% |
Volume Distribution (VD): | 2.004 | Fu: | 14.65% |
CYP1A2-inhibitor: | 0.934 | CYP1A2-substrate: | 0.636 |
CYP2C19-inhibitor: | 0.838 | CYP2C19-substrate: | 0.741 |
CYP2C9-inhibitor: | 0.574 | CYP2C9-substrate: | 0.034 |
CYP2D6-inhibitor: | 0.701 | CYP2D6-substrate: | 0.033 |
CYP3A4-inhibitor: | 0.926 | CYP3A4-substrate: | 0.622 |
Clearance (CL): | 2.931 | Half-life (T1/2): | 0.137 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.899 |
Drug-inuced Liver Injury (DILI): | 0.686 | AMES Toxicity: | 0.018 |
Rat Oral Acute Toxicity: | 0.889 | Maximum Recommended Daily Dose: | 0.704 |
Skin Sensitization: | 0.938 | Carcinogencity: | 0.367 |
Eye Corrosion: | 0.015 | Eye Irritation: | 0.048 |
Respiratory Toxicity: | 0.979 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002613 | 0.816 | D0E9KA | 0.200 | ||||
ENC002610 | 0.638 | D0C1SF | 0.198 | ||||
ENC002778 | 0.638 | D04KTZ | 0.195 | ||||
ENC002501 | 0.583 | D0R2KJ | 0.193 | ||||
ENC002612 | 0.520 | D0Q2AT | 0.193 | ||||
ENC002777 | 0.515 | D0JE2E | 0.191 | ||||
ENC004405 | 0.495 | D0L7LC | 0.187 | ||||
ENC002525 | 0.491 | D0R6RC | 0.186 | ||||
ENC005437 | 0.490 | D0C1QS | 0.183 | ||||
ENC002532 | 0.477 | D03KIA | 0.182 |