|
Name |
(+)-Pseudodeflectusin
|
Molecular Formula | C15H16O4 | |
IUPAC Name* |
(7R,9S)-9-hydroxy-7-methyl-2-propan-2-ylidene-7,9-dihydro-6H-furo[3,2-h]isochromen-3-one
|
|
SMILES |
C[C@@H]1CC2=C([C@H](O1)O)C3=C(C=C2)C(=O)C(=C(C)C)O3
|
|
InChI |
InChI=1S/C15H16O4/c1-7(2)13-12(16)10-5-4-9-6-8(3)18-15(17)11(9)14(10)19-13/h4-5,8,15,17H,6H2,1-3H3/t8-,15+/m1/s1
|
|
InChIKey |
LSQCSEQTJDZMSO-GLEZIHRCSA-N
|
|
Synonyms |
(+)-PSEUDODEFLECTUSIN; CHEMBL2419841
|
|
CAS | NA | |
PubChem CID | 24763831 | |
ChEMBL ID | CHEMBL2419841 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 260.28 | ALogp: | 2.5 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 55.8 | Aromatic Rings: | 3 |
Heavy Atoms: | 19 | QED Weighted: | 0.727 |
Caco-2 Permeability: | -5.003 | MDCK Permeability: | 0.00001290 |
Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.92 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.004 |
Blood-Brain-Barrier Penetration (BBB): | 0.097 | Plasma Protein Binding (PPB): | 92.40% |
Volume Distribution (VD): | 1.497 | Fu: | 10.62% |
CYP1A2-inhibitor: | 0.918 | CYP1A2-substrate: | 0.922 |
CYP2C19-inhibitor: | 0.104 | CYP2C19-substrate: | 0.876 |
CYP2C9-inhibitor: | 0.338 | CYP2C9-substrate: | 0.395 |
CYP2D6-inhibitor: | 0.108 | CYP2D6-substrate: | 0.259 |
CYP3A4-inhibitor: | 0.073 | CYP3A4-substrate: | 0.626 |
Clearance (CL): | 7.514 | Half-life (T1/2): | 0.815 |
hERG Blockers: | 0.022 | Human Hepatotoxicity (H-HT): | 0.961 |
Drug-inuced Liver Injury (DILI): | 0.986 | AMES Toxicity: | 0.707 |
Rat Oral Acute Toxicity: | 0.959 | Maximum Recommended Daily Dose: | 0.961 |
Skin Sensitization: | 0.765 | Carcinogencity: | 0.905 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.02 |
Respiratory Toxicity: | 0.953 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004986 | 0.754 | D0F7CS | 0.241 | ||||
ENC002979 | 0.625 | D0W6DG | 0.236 | ||||
ENC002693 | 0.486 | D03SKD | 0.232 | ||||
ENC002641 | 0.478 | D04JHN | 0.231 | ||||
ENC002640 | 0.451 | D02NSF | 0.226 | ||||
ENC003392 | 0.444 | D0X5KF | 0.223 | ||||
ENC001431 | 0.437 | D01XWG | 0.220 | ||||
ENC004297 | 0.368 | D01XDL | 0.220 | ||||
ENC002709 | 0.333 | D0T6WT | 0.219 | ||||
ENC004298 | 0.325 | D0H6QU | 0.211 |