|
Name |
3-(2-Carboxy-3-hydroxy-5-methoxyphenyl)-4-methyl-2-oxo-2H-pyran-6-carboxylic acid
|
Molecular Formula | C15H12O8 | |
IUPAC Name* |
5-(2-carboxy-3-hydroxy-5-methoxyphenyl)-4-methyl-6-oxopyran-2-carboxylic acid
|
|
SMILES |
CC1=C(C(=O)OC(=C1)C(=O)O)C2=C(C(=CC(=C2)OC)O)C(=O)O
|
|
InChI |
InChI=1S/C15H12O8/c1-6-3-10(13(17)18)23-15(21)11(6)8-4-7(22-2)5-9(16)12(8)14(19)20/h3-5,16H,1-2H3,(H,17,18)(H,19,20)
|
|
InChIKey |
DTWGKAWUEOJXKI-UHFFFAOYSA-N
|
|
Synonyms |
alternarian acid; 91868-93-8; Alternarian-acid; 3-(2-Carboxy-3-hydroxy-5-methoxyphenyl)-4-methyl-2-oxo-2H-pyran-6-carboxylic acid; SM5RXD78FE; 2H-Pyran-6-carboxylic acid, 3-(2-carboxy-3-hydroxy-5-methoxyphenyl)-4-methyl-2-oxo-; 5-(2-Carboxy-3-hydroxy-5-methoxy-phenyl)-4-methyl-6-oxo-pyran-2-carboxylic acid; UNII-SM5RXD78FE; MEGxm0_000135; CHEMBL1081907; SCHEMBL16224899; ACon0_001033; ACon1_000958; DTXSID30635940; ZINC13312152
|
|
CAS | 91868-93-8 | |
PubChem CID | 23928054 | |
ChEMBL ID | CHEMBL1081907 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 320.25 | ALogp: | 1.8 |
HBD: | 3 | HBA: | 8 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 130.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 23 | QED Weighted: | 0.781 |
Caco-2 Permeability: | -5.678 | MDCK Permeability: | 0.00001300 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.042 |
Human Intestinal Absorption (HIA): | 0.355 | 20% Bioavailability (F20%): | 0.888 |
30% Bioavailability (F30%): | 0.998 |
Blood-Brain-Barrier Penetration (BBB): | 0.03 | Plasma Protein Binding (PPB): | 84.94% |
Volume Distribution (VD): | 0.484 | Fu: | 8.11% |
CYP1A2-inhibitor: | 0.118 | CYP1A2-substrate: | 0.211 |
CYP2C19-inhibitor: | 0.038 | CYP2C19-substrate: | 0.037 |
CYP2C9-inhibitor: | 0.196 | CYP2C9-substrate: | 0.069 |
CYP2D6-inhibitor: | 0.033 | CYP2D6-substrate: | 0.093 |
CYP3A4-inhibitor: | 0.039 | CYP3A4-substrate: | 0.018 |
Clearance (CL): | 1.041 | Half-life (T1/2): | 0.897 |
hERG Blockers: | 0.048 | Human Hepatotoxicity (H-HT): | 0.316 |
Drug-inuced Liver Injury (DILI): | 0.985 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.02 | Maximum Recommended Daily Dose: | 0.009 |
Skin Sensitization: | 0.113 | Carcinogencity: | 0.013 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.463 |
Respiratory Toxicity: | 0.294 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004131 | 0.671 | D06FVX | 0.354 | ||||
ENC001896 | 0.539 | D06NSS | 0.300 | ||||
ENC002518 | 0.520 | D07MGA | 0.284 | ||||
ENC006051 | 0.481 | D0G7IY | 0.279 | ||||
ENC006073 | 0.446 | D0N1FS | 0.276 | ||||
ENC005416 | 0.437 | D00KRE | 0.274 | ||||
ENC000966 | 0.429 | D06GCK | 0.262 | ||||
ENC000336 | 0.429 | D0R1RS | 0.262 | ||||
ENC005159 | 0.425 | D0G5UB | 0.260 | ||||
ENC002933 | 0.425 | D0FA2O | 0.256 |