|
Name |
Paecilin A
|
Molecular Formula | C32H30O14 | |
IUPAC Name* |
methyl 5-hydroxy-8-[5-hydroxy-2-methoxycarbonyl-2-(3-methyl-5-oxooxolan-2-yl)-4-oxo-3H-chromen-8-yl]-2-(3-methyl-5-oxooxolan-2-yl)-4-oxo-3H-chromene-2-carboxylate
|
|
SMILES |
CC1CC(=O)OC1C2(CC(=O)C3=C(C=CC(=C3O2)C4=C5C(=C(C=C4)O)C(=O)CC(O5)(C6C(CC(=O)O6)C)C(=O)OC)O)C(=O)OC
|
|
InChI |
InChI=1S/C32H30O14/c1-13-9-21(37)43-27(13)31(29(39)41-3)11-19(35)23-17(33)7-5-15(25(23)45-31)16-6-8-18(34)24-20(36)12-32(30(40)42-4,46-26(16)24)28-14(2)10-22(38)44-28/h5-8,13-14,27-28,33-34H,9-12H2,1-4H3
|
|
InChIKey |
UJORNCQXCUJGMA-UHFFFAOYSA-N
|
|
Synonyms |
Paecilin A; methyl 5-hydroxy-8-[5-hydroxy-2-methoxycarbonyl-2-(3-methyl-5-oxooxolan-2-yl)-4-oxo-3H-chromen-8-yl]-2-(3-methyl-5-oxooxolan-2-yl)-4-oxo-3H-chromene-2-carboxylate
|
|
CAS | NA | |
PubChem CID | 23582930 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 638.6 | ALogp: | 3.3 |
HBD: | 2 | HBA: | 14 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 198.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 46 | QED Weighted: | 0.357 |
Caco-2 Permeability: | -5.153 | MDCK Permeability: | 0.00003000 |
Pgp-inhibitor: | 0.742 | Pgp-substrate: | 0.004 |
Human Intestinal Absorption (HIA): | 0.712 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.756 |
Blood-Brain-Barrier Penetration (BBB): | 0.025 | Plasma Protein Binding (PPB): | 84.78% |
Volume Distribution (VD): | 0.344 | Fu: | 7.23% |
CYP1A2-inhibitor: | 0.044 | CYP1A2-substrate: | 0.737 |
CYP2C19-inhibitor: | 0.3 | CYP2C19-substrate: | 0.065 |
CYP2C9-inhibitor: | 0.747 | CYP2C9-substrate: | 0.726 |
CYP2D6-inhibitor: | 0.067 | CYP2D6-substrate: | 0.179 |
CYP3A4-inhibitor: | 0.891 | CYP3A4-substrate: | 0.477 |
Clearance (CL): | 15.865 | Half-life (T1/2): | 0.066 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.794 |
Drug-inuced Liver Injury (DILI): | 0.971 | AMES Toxicity: | 0.055 |
Rat Oral Acute Toxicity: | 0.94 | Maximum Recommended Daily Dose: | 0.1 |
Skin Sensitization: | 0.016 | Carcinogencity: | 0.148 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
Respiratory Toxicity: | 0.004 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005731 | 1.000 | D01XWG | 0.258 | ||||
ENC005733 | 0.775 | D01UBX | 0.256 | ||||
ENC005732 | 0.684 | D0T5XN | 0.252 | ||||
ENC003348 | 0.641 | D01XDL | 0.251 | ||||
ENC005727 | 0.610 | D07VLY | 0.247 | ||||
ENC005729 | 0.600 | D0C9XJ | 0.247 | ||||
ENC005885 | 0.569 | D07IPB | 0.239 | ||||
ENC005734 | 0.543 | D0T8EH | 0.236 | ||||
ENC005735 | 0.533 | D08LTU | 0.231 | ||||
ENC005736 | 0.524 | D0Q0PR | 0.231 |