|
Name |
oxalicine B
|
Molecular Formula | C30H33NO7 | |
IUPAC Name* |
NA
|
|
SMILES |
CC1=CC[C@H]2[C@]([C@]13[C@H](C4=C(O3)C=C(OC4=O)C5=CN=CC=C5)O)(CC[C@]([C@]26CCC(=O)OC6)(C(=C)C)O)C
|
|
InChI |
InChI=1S/C30H33NO7/c1-17(2)29(35)12-11-27(4)22(28(29)10-9-23(32)36-16-28)8-7-18(3)30(27)25(33)24-21(38-30)14-20(37-26(24)34)19-6-5-13-31-15-19/h5-7,13-15,22,25,33,35H,1,8-12,16H2,2-4H3/t22-,25-,27+,28-,29+,30+/m0/s1
|
|
InChIKey |
GADSICAILMLRQB-GVRUMSNVSA-N
|
|
Synonyms |
oxalicine B; CHEMBL474673; ZINC40915180; NCGC00380810-01!; (3R,2'R,5'S)-2'beta,3''beta-Dihydroxy-6''-(3-pyridyl)-2'-isopropenyl-4'aalpha,6'-dimethyl-3',4',4'a,8'abeta-tetrahydrodispiro[2H-pyran-3(4H),1'(2'H)-naphthalene-5'(8'H),2''(3''H)-[4H]furo[3,2-c]pyran]-6,4''(5H)-dione
|
|
CAS | NA | |
PubChem CID | 21593946 | |
ChEMBL ID | CHEMBL474673 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 519.6 | ALogp: | 2.3 |
HBD: | 2 | HBA: | 8 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 115.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 38 | QED Weighted: | 0.428 |
Caco-2 Permeability: | -4.887 | MDCK Permeability: | 0.00002000 |
Pgp-inhibitor: | 0.112 | Pgp-substrate: | 0.505 |
Human Intestinal Absorption (HIA): | 0.079 | 20% Bioavailability (F20%): | 0.283 |
30% Bioavailability (F30%): | 0.919 |
Blood-Brain-Barrier Penetration (BBB): | 0.868 | Plasma Protein Binding (PPB): | 76.02% |
Volume Distribution (VD): | 1.507 | Fu: | 20.19% |
CYP1A2-inhibitor: | 0.139 | CYP1A2-substrate: | 0.833 |
CYP2C19-inhibitor: | 0.346 | CYP2C19-substrate: | 0.593 |
CYP2C9-inhibitor: | 0.323 | CYP2C9-substrate: | 0.061 |
CYP2D6-inhibitor: | 0.012 | CYP2D6-substrate: | 0.101 |
CYP3A4-inhibitor: | 0.925 | CYP3A4-substrate: | 0.639 |
Clearance (CL): | 5.927 | Half-life (T1/2): | 0.428 |
hERG Blockers: | 0.587 | Human Hepatotoxicity (H-HT): | 0.787 |
Drug-inuced Liver Injury (DILI): | 0.807 | AMES Toxicity: | 0.024 |
Rat Oral Acute Toxicity: | 0.902 | Maximum Recommended Daily Dose: | 0.974 |
Skin Sensitization: | 0.217 | Carcinogencity: | 0.581 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
Respiratory Toxicity: | 0.929 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002410 | 0.765 | D06CNP | 0.286 | ||||
ENC003611 | 0.669 | D02STN | 0.284 | ||||
ENC002080 | 0.641 | D04GJN | 0.243 | ||||
ENC004976 | 0.575 | D0V4WD | 0.234 | ||||
ENC002102 | 0.522 | D0Q4SD | 0.226 | ||||
ENC002118 | 0.500 | D0EP0C | 0.222 | ||||
ENC003423 | 0.500 | D02CNR | 0.220 | ||||
ENC002412 | 0.496 | D0I2SD | 0.217 | ||||
ENC003422 | 0.478 | D0IX6I | 0.212 | ||||
ENC005020 | 0.394 | D0IL7L | 0.212 |