|
Name |
epi-isochromophilone II
|
Molecular Formula | C22H27ClO4 | |
IUPAC Name* |
(7R,8S)-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-7-hydroxy-7-methyl-8-(2-oxopropyl)-8H-isochromen-6-one
|
|
SMILES |
CC[C@H](C)/C=C(\C)/C=C/C1=CC2=C(C(=O)[C@]([C@H](C2=CO1)CC(=O)C)(C)O)Cl
|
|
InChI |
InChI=1S/C22H27ClO4/c1-6-13(2)9-14(3)7-8-16-11-17-18(12-27-16)19(10-15(4)24)22(5,26)21(25)20(17)23/h7-9,11-13,19,26H,6,10H2,1-5H3/b8-7+,14-9+/t13-,19-,22+/m0/s1
|
|
InChIKey |
QEPMTPAOVMUVBT-NJCRSHSXSA-N
|
|
Synonyms |
epi-isochromophilone II; CHEMBL4276939; CHEBI:68700; DTXSID301314037; Q27137121; (7R,8S)-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dien-1-yl]-7-hydroxy-7-methyl-8-(2-oxopropyl)-7,8-dihydro-6H-isochromen-6-one; (7R,8S)-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-7-hydroxy-7-methyl-8-(2-oxopropyl)-8H-isochromen-6-one; 901309-50-0
|
|
CAS | 901309-50-0 | |
PubChem CID | 11661102 | |
ChEMBL ID | CHEMBL4276939 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 390.9 | ALogp: | 3.8 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 63.6 | Aromatic Rings: | 2 |
Heavy Atoms: | 27 | QED Weighted: | 0.635 |
Caco-2 Permeability: | -4.623 | MDCK Permeability: | 0.00002380 |
Pgp-inhibitor: | 0.046 | Pgp-substrate: | 0.057 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.989 | Plasma Protein Binding (PPB): | 87.10% |
Volume Distribution (VD): | 1.685 | Fu: | 11.65% |
CYP1A2-inhibitor: | 0.927 | CYP1A2-substrate: | 0.58 |
CYP2C19-inhibitor: | 0.955 | CYP2C19-substrate: | 0.456 |
CYP2C9-inhibitor: | 0.908 | CYP2C9-substrate: | 0.653 |
CYP2D6-inhibitor: | 0.923 | CYP2D6-substrate: | 0.122 |
CYP3A4-inhibitor: | 0.945 | CYP3A4-substrate: | 0.537 |
Clearance (CL): | 2.362 | Half-life (T1/2): | 0.335 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.848 |
Drug-inuced Liver Injury (DILI): | 0.555 | AMES Toxicity: | 0.235 |
Rat Oral Acute Toxicity: | 0.759 | Maximum Recommended Daily Dose: | 0.976 |
Skin Sensitization: | 0.919 | Carcinogencity: | 0.951 |
Eye Corrosion: | 0.006 | Eye Irritation: | 0.252 |
Respiratory Toxicity: | 0.979 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001876 | 0.744 | D05QDC | 0.225 | ||||
ENC002612 | 0.714 | D0B1IP | 0.224 | ||||
ENC005844 | 0.640 | D0G3PI | 0.213 | ||||
ENC005878 | 0.640 | D02DGU | 0.213 | ||||
ENC005436 | 0.635 | D00DKK | 0.213 | ||||
ENC005435 | 0.635 | D0S7WX | 0.206 | ||||
ENC001841 | 0.618 | D0WY9N | 0.194 | ||||
ENC002778 | 0.604 | D06BLQ | 0.188 | ||||
ENC002610 | 0.604 | D0E9KA | 0.185 | ||||
ENC005437 | 0.586 | D06AEO | 0.182 |