|
Name |
asperpyrone C
|
Molecular Formula | C32H26O10 | |
IUPAC Name* |
5-hydroxy-7-(5-hydroxy-8,10-dimethoxy-2-methyl-4-oxobenzo[h]chromen-6-yl)-6,8-dimethoxy-2-methylbenzo[g]chromen-4-one
|
|
SMILES |
CC1=CC(=O)C2=C(O1)C=C3C=C(C(=C(C3=C2O)OC)C4=C(C5=C(C6=C4C=C(C=C6OC)OC)OC(=CC5=O)C)O)OC
|
|
InChI |
InChI=1S/C32H26O10/c1-13-7-18(33)26-22(41-13)10-15-9-20(38-4)28(31(40-6)23(15)29(26)35)25-17-11-16(37-3)12-21(39-5)24(17)32-27(30(25)36)19(34)8-14(2)42-32/h7-12,35-36H,1-6H3
|
|
InChIKey |
YVLPJBAIVAPEFU-UHFFFAOYSA-N
|
|
Synonyms |
asperpyrone C; 491869-00-2; CHEMBL446958; CHEBI:133762; DTXSID801101372; (7R)-5-Hydroxy-7-(5-hydroxy-8,10-dimethoxy-2-methyl-4-oxo-4H-naphtho[1,2-b]pyran-6-yl)-6,8-dimethoxy-2-methyl-4H-naphtho[2,3-b]pyran-4-one; 5-hydroxy-7-(5-hydroxy-8,10-dimethoxy-2-methyl-4-oxo-4H-naphtho[1,2-b]pyran-6-yl)-6,8-dimethoxy-2-methyl-4H-naphtho[2,3-b]pyran-4-one; 5-hydroxy-7-(5-hydroxy-8,10-dimethoxy-2-methyl-4-oxobenzo[h]chromen-6-yl)-6,8-dimethoxy-2-methylbenzo[g]chromen-4-one
|
|
CAS | 491869-00-2 | |
PubChem CID | 10995389 | |
ChEMBL ID | CHEMBL446958 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 570.5 | ALogp: | 6.3 |
HBD: | 2 | HBA: | 10 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 130.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 42 | QED Weighted: | 0.187 |
Caco-2 Permeability: | -5.079 | MDCK Permeability: | 0.00002390 |
Pgp-inhibitor: | 0.97 | Pgp-substrate: | 0.095 |
Human Intestinal Absorption (HIA): | 0.359 | 20% Bioavailability (F20%): | 0.001 |
30% Bioavailability (F30%): | 0.329 |
Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 64.57% |
Volume Distribution (VD): | 0.449 | Fu: | 48.16% |
CYP1A2-inhibitor: | 0.177 | CYP1A2-substrate: | 0.989 |
CYP2C19-inhibitor: | 0.455 | CYP2C19-substrate: | 0.597 |
CYP2C9-inhibitor: | 0.757 | CYP2C9-substrate: | 0.937 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.909 |
CYP3A4-inhibitor: | 0.087 | CYP3A4-substrate: | 0.254 |
Clearance (CL): | 2.657 | Half-life (T1/2): | 0.122 |
hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.128 |
Drug-inuced Liver Injury (DILI): | 0.982 | AMES Toxicity: | 0.124 |
Rat Oral Acute Toxicity: | 0.199 | Maximum Recommended Daily Dose: | 0.897 |
Skin Sensitization: | 0.192 | Carcinogencity: | 0.018 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.396 |
Respiratory Toxicity: | 0.089 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001501 | 0.933 | D06GCK | 0.381 | ||||
ENC002002 | 0.841 | D0G4KG | 0.290 | ||||
ENC000922 | 0.832 | D02LZB | 0.282 | ||||
ENC003507 | 0.832 | D09DHY | 0.281 | ||||
ENC003154 | 0.798 | D0NJ3V | 0.272 | ||||
ENC000912 | 0.775 | D0V8HJ | 0.249 | ||||
ENC003149 | 0.733 | D0D4HN | 0.248 | ||||
ENC001411 | 0.709 | D0Y6CE | 0.245 | ||||
ENC000984 | 0.708 | D0Y7TS | 0.240 | ||||
ENC003048 | 0.671 | D0V6OA | 0.240 |