|
Name |
Cytosporone D
|
Molecular Formula | C16H22O5 | |
IUPAC Name* |
1-heptyl-6,7,8-trihydroxy-1,4-dihydroisochromen-3-one
|
|
SMILES |
CCCCCCCC1C2=C(C(=C(C=C2CC(=O)O1)O)O)O
|
|
InChI |
InChI=1S/C16H22O5/c1-2-3-4-5-6-7-12-14-10(9-13(18)21-12)8-11(17)15(19)16(14)20/h8,12,17,19-20H,2-7,9H2,1H3
|
|
InChIKey |
DCRCESNMLPVESY-UHFFFAOYSA-N
|
|
Synonyms |
Cytosporone D
|
|
CAS | NA | |
PubChem CID | 10661454 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 294.34 | ALogp: | 3.7 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 21 | QED Weighted: | 0.418 |
Caco-2 Permeability: | -4.796 | MDCK Permeability: | 0.00002870 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.018 |
Human Intestinal Absorption (HIA): | 0.026 | 20% Bioavailability (F20%): | 0.985 |
30% Bioavailability (F30%): | 0.984 |
Blood-Brain-Barrier Penetration (BBB): | 0.016 | Plasma Protein Binding (PPB): | 97.67% |
Volume Distribution (VD): | 0.394 | Fu: | 2.94% |
CYP1A2-inhibitor: | 0.272 | CYP1A2-substrate: | 0.597 |
CYP2C19-inhibitor: | 0.347 | CYP2C19-substrate: | 0.162 |
CYP2C9-inhibitor: | 0.709 | CYP2C9-substrate: | 0.924 |
CYP2D6-inhibitor: | 0.092 | CYP2D6-substrate: | 0.225 |
CYP3A4-inhibitor: | 0.297 | CYP3A4-substrate: | 0.148 |
Clearance (CL): | 11.004 | Half-life (T1/2): | 0.901 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.132 |
Drug-inuced Liver Injury (DILI): | 0.743 | AMES Toxicity: | 0.422 |
Rat Oral Acute Toxicity: | 0.204 | Maximum Recommended Daily Dose: | 0.144 |
Skin Sensitization: | 0.94 | Carcinogencity: | 0.106 |
Eye Corrosion: | 0.009 | Eye Irritation: | 0.881 |
Respiratory Toxicity: | 0.24 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002006 | 0.738 | D0L7AS | 0.294 | ||||
ENC002062 | 0.727 | D0O1UZ | 0.274 | ||||
ENC005187 | 0.568 | D0I4DQ | 0.270 | ||||
ENC004179 | 0.500 | D0XN8C | 0.258 | ||||
ENC002935 | 0.361 | D0P1FO | 0.258 | ||||
ENC003233 | 0.360 | D00CTS | 0.245 | ||||
ENC000863 | 0.356 | D03ZJE | 0.245 | ||||
ENC002047 | 0.353 | D04VKS | 0.237 | ||||
ENC002753 | 0.350 | D09ANG | 0.234 | ||||
ENC002066 | 0.350 | D07MGA | 0.227 |