|
Name |
spirotryprostatin A
|
Molecular Formula | C22H25N3O4 | |
IUPAC Name* |
(3S,5S,6S,9S)-6'-methoxy-6-(2-methylprop-1-enyl)spiro[1,7-diazatricyclo[7.3.0.03,7]dodecane-5,3'-1H-indole]-2,2',8-trione
|
|
SMILES |
CC(=C[C@H]1[C@]2(C[C@@H]3N1C(=O)[C@@H]4CCCN4C3=O)C5=C(C=C(C=C5)OC)NC2=O)C
|
|
InChI |
InChI=1S/C22H25N3O4/c1-12(2)9-18-22(14-7-6-13(29-3)10-15(14)23-21(22)28)11-17-19(26)24-8-4-5-16(24)20(27)25(17)18/h6-7,9-10,16-18H,4-5,8,11H2,1-3H3,(H,23,28)/t16-,17-,18-,22-/m0/s1
|
|
InChIKey |
MQJKGSIAJNXSCM-ORGXJRBJSA-N
|
|
Synonyms |
spirotryprostatin A; (3S,3'S,5'aS,10'aS)-6-Methoxy-3'-(2-methylprop-1-enyl)spiro[1H-indole-3,2'-3,5a,6,7,8,10a-hexahydro-1H-dipyrrolo[1,2-c:1',4'-f]pyrazine]-2,5',10'-trione; CHEMBL549475; SCHEMBL2632404; DTXSID501046361; (3S,5S,6S,9S)-6'-methoxy-6-(2-methylprop-1-enyl)spiro[1,7-diazatricyclo[7.3.0.03,7]dodecane-5,3'-1H-indole]-2,2',8-trione; 182234-25-9
|
|
CAS | 182234-25-9 | |
PubChem CID | 10408374 | |
ChEMBL ID | CHEMBL549475 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 395.5 | ALogp: | 1.7 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 79.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 29 | QED Weighted: | 0.78 |
Caco-2 Permeability: | -5.181 | MDCK Permeability: | 0.00002110 |
Pgp-inhibitor: | 0.683 | Pgp-substrate: | 0.921 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.281 |
30% Bioavailability (F30%): | 0.952 |
Blood-Brain-Barrier Penetration (BBB): | 0.617 | Plasma Protein Binding (PPB): | 84.28% |
Volume Distribution (VD): | 0.895 | Fu: | 15.86% |
CYP1A2-inhibitor: | 0.013 | CYP1A2-substrate: | 0.468 |
CYP2C19-inhibitor: | 0.532 | CYP2C19-substrate: | 0.853 |
CYP2C9-inhibitor: | 0.214 | CYP2C9-substrate: | 0.57 |
CYP2D6-inhibitor: | 0.013 | CYP2D6-substrate: | 0.19 |
CYP3A4-inhibitor: | 0.235 | CYP3A4-substrate: | 0.904 |
Clearance (CL): | 12.927 | Half-life (T1/2): | 0.161 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.927 |
Drug-inuced Liver Injury (DILI): | 0.915 | AMES Toxicity: | 0.026 |
Rat Oral Acute Toxicity: | 0.685 | Maximum Recommended Daily Dose: | 0.794 |
Skin Sensitization: | 0.66 | Carcinogencity: | 0.093 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.179 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002520 | 0.653 | D09OBB | 0.275 | ||||
ENC002274 | 0.584 | D06HBQ | 0.269 | ||||
ENC001060 | 0.584 | D0Q5NX | 0.252 | ||||
ENC005479 | 0.551 | D02DPU | 0.248 | ||||
ENC003264 | 0.477 | D06YFA | 0.242 | ||||
ENC001958 | 0.477 | D0P0RX | 0.240 | ||||
ENC003265 | 0.465 | D03DDR | 0.240 | ||||
ENC003322 | 0.459 | D02IQY | 0.235 | ||||
ENC005204 | 0.444 | D00XHD | 0.234 | ||||
ENC002519 | 0.434 | D0L0ZF | 0.233 |