|
Name |
(2R,3S,4aS,7R,8R,8aS)-2,3,4'-trihydroxy-4,4,7,8a-tetramethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-6,7-dihydro-3H-furo[3,2-g]isoindole]-8'-one
|
Molecular Formula | C23H31NO5 | |
IUPAC Name* |
(2R,3S,4aS,7R,8R,8aS)-2,3,4'-trihydroxy-4,4,7,8a-tetramethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-6,7-dihydro-3H-furo[3,2-g]isoindole]-8'-one
|
|
SMILES |
C[C@@H]1CC[C@@H]2[C@@]([C@@]13CC4=C(C=C5CNC(=O)C5=C4O3)O)(C[C@H]([C@H](C2(C)C)O)O)C
|
|
InChI |
InChI=1S/C23H31NO5/c1-11-5-6-16-21(2,3)19(27)15(26)9-22(16,4)23(11)8-13-14(25)7-12-10-24-20(28)17(12)18(13)29-23/h7,11,15-16,19,25-27H,5-6,8-10H2,1-4H3,(H,24,28)/t11-,15-,16+,19-,22+,23-/m1/s1
|
|
InChIKey |
NAYYHXFGJRKHMB-OKXHAOHDSA-N
|
|
Synonyms |
F1839-D
|
|
CAS | NA | |
PubChem CID | 10363682 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 401.5 | ALogp: | 2.8 |
HBD: | 4 | HBA: | 5 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 99.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 29 | QED Weighted: | 0.535 |
Caco-2 Permeability: | -4.935 | MDCK Permeability: | 0.00000532 |
Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0.984 |
Human Intestinal Absorption (HIA): | 0.026 | 20% Bioavailability (F20%): | 0.296 |
30% Bioavailability (F30%): | 0.006 |
Blood-Brain-Barrier Penetration (BBB): | 0.348 | Plasma Protein Binding (PPB): | 94.74% |
Volume Distribution (VD): | 0.777 | Fu: | 10.39% |
CYP1A2-inhibitor: | 0.239 | CYP1A2-substrate: | 0.595 |
CYP2C19-inhibitor: | 0.041 | CYP2C19-substrate: | 0.277 |
CYP2C9-inhibitor: | 0.571 | CYP2C9-substrate: | 0.823 |
CYP2D6-inhibitor: | 0.563 | CYP2D6-substrate: | 0.287 |
CYP3A4-inhibitor: | 0.131 | CYP3A4-substrate: | 0.179 |
Clearance (CL): | 11.161 | Half-life (T1/2): | 0.529 |
hERG Blockers: | 0.058 | Human Hepatotoxicity (H-HT): | 0.282 |
Drug-inuced Liver Injury (DILI): | 0.084 | AMES Toxicity: | 0.01 |
Rat Oral Acute Toxicity: | 0.977 | Maximum Recommended Daily Dose: | 0.958 |
Skin Sensitization: | 0.918 | Carcinogencity: | 0.125 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.169 |
Respiratory Toxicity: | 0.945 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003012 | 1.000 | D0D2TN | 0.267 | ||||
ENC003009 | 0.816 | D0D1SG | 0.261 | ||||
ENC003789 | 0.773 | D0KR5B | 0.261 | ||||
ENC002995 | 0.773 | D08PIQ | 0.256 | ||||
ENC001965 | 0.660 | D0Z1FX | 0.255 | ||||
ENC003259 | 0.644 | D0L2LS | 0.252 | ||||
ENC005396 | 0.625 | D02JNM | 0.248 | ||||
ENC003552 | 0.596 | D04VIS | 0.246 | ||||
ENC003008 | 0.577 | D04SFH | 0.246 | ||||
ENC003014 | 0.559 | D0Y2YP | 0.244 |