|
Name |
Shornephine A
|
Molecular Formula | C25H26N2O5 | |
IUPAC Name* |
(1R,4S,7S,9S)-4-benzyl-9,14-dihydroxy-1-(2-methylbut-3-en-2-yl)-5-oxa-2,16-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-10(15),11,13-triene-3,6-dione
|
|
SMILES |
CC(C)(C=C)[C@]12[C@](C[C@@H]3N1C(=O)[C@@H](OC3=O)CC4=CC=CC=C4)(C5=C(N2)C(=CC=C5)O)O
|
|
InChI |
InChI=1S/C25H26N2O5/c1-4-23(2,3)25-24(31,16-11-8-12-18(28)20(16)26-25)14-17-22(30)32-19(21(29)27(17)25)13-15-9-6-5-7-10-15/h4-12,17,19,26,28,31H,1,13-14H2,2-3H3/t17-,19-,24-,25+/m0/s1
|
|
InChIKey |
VMKCIRAJEVFSFR-LQTXRJQHSA-N
|
|
Synonyms |
Shornephine A; CHEMBL4205964; (1R,4S,7S,9S)-4-benzyl-9,14-dihydroxy-1-(2-methylbut-3-en-2-yl)-5-oxa-2,16-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-10(15),11,13-triene-3,6-dione
|
|
CAS | NA | |
PubChem CID | 10194855 | |
ChEMBL ID | CHEMBL4205964 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 434.5 | ALogp: | 3.6 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 99.1 | Aromatic Rings: | 5 |
Heavy Atoms: | 32 | QED Weighted: | 0.387 |
Caco-2 Permeability: | -4.866 | MDCK Permeability: | 0.00002240 |
Pgp-inhibitor: | 0.101 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.031 | Plasma Protein Binding (PPB): | 91.47% |
Volume Distribution (VD): | 0.849 | Fu: | 4.80% |
CYP1A2-inhibitor: | 0.04 | CYP1A2-substrate: | 0.108 |
CYP2C19-inhibitor: | 0.951 | CYP2C19-substrate: | 0.795 |
CYP2C9-inhibitor: | 0.966 | CYP2C9-substrate: | 0.873 |
CYP2D6-inhibitor: | 0.645 | CYP2D6-substrate: | 0.137 |
CYP3A4-inhibitor: | 0.971 | CYP3A4-substrate: | 0.954 |
Clearance (CL): | 6.183 | Half-life (T1/2): | 0.234 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.156 |
Drug-inuced Liver Injury (DILI): | 0.899 | AMES Toxicity: | 0.014 |
Rat Oral Acute Toxicity: | 0.851 | Maximum Recommended Daily Dose: | 0.942 |
Skin Sensitization: | 0.27 | Carcinogencity: | 0.94 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
Respiratory Toxicity: | 0.493 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004263 | 0.432 | D01TSI | 0.317 | ||||
ENC004262 | 0.422 | D0V3ZA | 0.309 | ||||
ENC002365 | 0.417 | D09NNH | 0.299 | ||||
ENC002594 | 0.412 | D0SP3D | 0.298 | ||||
ENC006112 | 0.410 | D06ZPS | 0.276 | ||||
ENC003246 | 0.389 | D0D7KC | 0.275 | ||||
ENC003221 | 0.389 | D0I0DL | 0.274 | ||||
ENC004609 | 0.387 | D0QV5T | 0.274 | ||||
ENC004645 | 0.382 | D0E3OF | 0.273 | ||||
ENC004607 | 0.366 | D0J5YC | 0.272 |