|
Name |
Fungerin
|
Molecular Formula | C13H18N2O2 | |
IUPAC Name* |
methyl (E)-3-[1-methyl-5-(3-methylbut-2-enyl)imidazol-4-yl]prop-2-enoate
|
|
SMILES |
CC(=CCC1=C(N=CN1C)/C=C/C(=O)OC)C
|
|
InChI |
InChI=1S/C13H18N2O2/c1-10(2)5-7-12-11(14-9-15(12)3)6-8-13(16)17-4/h5-6,8-9H,7H2,1-4H3/b8-6+
|
|
InChIKey |
LLJZWVUHEIKSRC-SOFGYWHQSA-N
|
|
Synonyms |
Fungerin; 185681-81-6; Methyl (E)-3-[1-methyl-5-(3-methylbut-2-enyl)imidazol-4-yl]prop-2-enoate; MFCD08274577; ZINC15219844; AKOS030213193; BS-1185
|
|
CAS | NA | |
PubChem CID | 10082774 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 234.29 | ALogp: | 2.3 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 44.1 | Aromatic Rings: | 1 |
Heavy Atoms: | 17 | QED Weighted: | 0.457 |
Caco-2 Permeability: | -4.675 | MDCK Permeability: | 0.00001830 |
Pgp-inhibitor: | 0.069 | Pgp-substrate: | 0.058 |
Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.034 |
30% Bioavailability (F30%): | 0.451 |
Blood-Brain-Barrier Penetration (BBB): | 0.98 | Plasma Protein Binding (PPB): | 66.94% |
Volume Distribution (VD): | 1.002 | Fu: | 21.96% |
CYP1A2-inhibitor: | 0.867 | CYP1A2-substrate: | 0.666 |
CYP2C19-inhibitor: | 0.543 | CYP2C19-substrate: | 0.752 |
CYP2C9-inhibitor: | 0.171 | CYP2C9-substrate: | 0.503 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.322 |
CYP3A4-inhibitor: | 0.043 | CYP3A4-substrate: | 0.295 |
Clearance (CL): | 11.093 | Half-life (T1/2): | 0.892 |
hERG Blockers: | 0.033 | Human Hepatotoxicity (H-HT): | 0.925 |
Drug-inuced Liver Injury (DILI): | 0.195 | AMES Toxicity: | 0.052 |
Rat Oral Acute Toxicity: | 0.882 | Maximum Recommended Daily Dose: | 0.315 |
Skin Sensitization: | 0.799 | Carcinogencity: | 0.367 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.04 |
Respiratory Toxicity: | 0.864 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002176 | 0.759 | D0A7MY | 0.263 | ||||
ENC005659 | 0.745 | D0B1IP | 0.234 | ||||
ENC005660 | 0.516 | D05QDC | 0.222 | ||||
ENC005658 | 0.516 | D09QEI | 0.220 | ||||
ENC005654 | 0.471 | D0B3HD | 0.203 | ||||
ENC005653 | 0.470 | D06BLQ | 0.200 | ||||
ENC005662 | 0.412 | D0M1PQ | 0.200 | ||||
ENC005650 | 0.394 | D0S7WX | 0.198 | ||||
ENC001720 | 0.356 | D00DKK | 0.193 | ||||
ENC001719 | 0.356 | D0G3PI | 0.193 |