|
Name |
6,8-Dihydroxy-3-(hydroxymethyl)-1H-2-benzopyran-1-one
|
Molecular Formula | C10H8O5 | |
IUPAC Name* |
6,8-dihydroxy-3-(hydroxymethyl)isochromen-1-one
|
|
SMILES |
C1=C2C=C(OC(=O)C2=C(C=C1O)O)CO
|
|
InChI |
InChI=1S/C10H8O5/c11-4-7-2-5-1-6(12)3-8(13)9(5)10(14)15-7/h1-3,11-13H,4H2
|
|
InChIKey |
BKFBBKNNGTZBPF-UHFFFAOYSA-N
|
|
Synonyms |
62209-16-9; 6,8-dihydroxy-3-hydroxymethylisocoumarin; CHEMBL539432; 6,8-Dihydroxy-3-(hydroxymethyl)-1H-2-benzopyran-1-one; SCHEMBL17866981; DTXSID80433771; 3-(Hydroxymethyl)-6,8-dihydroxyisocoumarin; 6,8-dihydroxy-3-hydroxymethyl isocou-marin
|
|
CAS | 62209-16-9 | |
PubChem CID | 9990614 | |
ChEMBL ID | CHEMBL539432 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 208.17 | ALogp: | 0.9 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 15 | QED Weighted: | 0.652 |
Caco-2 Permeability: | -4.858 | MDCK Permeability: | 0.00000975 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.953 |
Human Intestinal Absorption (HIA): | 0.031 | 20% Bioavailability (F20%): | 0.969 |
30% Bioavailability (F30%): | 0.999 |
Blood-Brain-Barrier Penetration (BBB): | 0.036 | Plasma Protein Binding (PPB): | 58.60% |
Volume Distribution (VD): | 0.724 | Fu: | 38.29% |
CYP1A2-inhibitor: | 0.904 | CYP1A2-substrate: | 0.217 |
CYP2C19-inhibitor: | 0.049 | CYP2C19-substrate: | 0.057 |
CYP2C9-inhibitor: | 0.092 | CYP2C9-substrate: | 0.856 |
CYP2D6-inhibitor: | 0.094 | CYP2D6-substrate: | 0.382 |
CYP3A4-inhibitor: | 0.088 | CYP3A4-substrate: | 0.089 |
Clearance (CL): | 10.389 | Half-life (T1/2): | 0.91 |
hERG Blockers: | 0.037 | Human Hepatotoxicity (H-HT): | 0.142 |
Drug-inuced Liver Injury (DILI): | 0.896 | AMES Toxicity: | 0.136 |
Rat Oral Acute Toxicity: | 0.041 | Maximum Recommended Daily Dose: | 0.119 |
Skin Sensitization: | 0.914 | Carcinogencity: | 0.036 |
Eye Corrosion: | 0.045 | Eye Irritation: | 0.937 |
Respiratory Toxicity: | 0.192 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001569 | 0.740 | D04AIT | 0.375 | ||||
ENC004556 | 0.740 | D0K8KX | 0.365 | ||||
ENC004676 | 0.681 | D07EXH | 0.327 | ||||
ENC005370 | 0.681 | D07MGA | 0.308 | ||||
ENC001542 | 0.681 | D02UFG | 0.266 | ||||
ENC002509 | 0.673 | D0M8RC | 0.258 | ||||
ENC005393 | 0.661 | D06GCK | 0.250 | ||||
ENC002933 | 0.647 | D0FA2O | 0.239 | ||||
ENC005299 | 0.638 | D08HVR | 0.238 | ||||
ENC004995 | 0.638 | D07MOX | 0.237 |