|
Name |
Nonaprenyl-4-hydroxybenzoate
|
Molecular Formula | C52H78O3 | |
IUPAC Name* |
4-hydroxy-3-[(2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenyl]benzoic acid
|
|
SMILES |
CC(=CCC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC1=C(C=CC(=C1)C(=O)O)O)/C)/C)/C)/C)/C)/C)/C)/C)C
|
|
InChI |
InChI=1S/C52H78O3/c1-40(2)19-11-20-41(3)21-12-22-42(4)23-13-24-43(5)25-14-26-44(6)27-15-28-45(7)29-16-30-46(8)31-17-32-47(9)33-18-34-48(10)35-36-49-39-50(52(54)55)37-38-51(49)53/h19,21,23,25,27,29,31,33,35,37-39,53H,11-18,20,22,24,26,28,30,32,34,36H2,1-10H3,(H,54,55)/b41-21+,42-23+,43-25+,44-27+,45-29+,46-31+,47-33+,48-35+
|
|
InChIKey |
YKKKMRBEPIZPBH-XWEAJCOCSA-N
|
|
Synonyms |
Nonaprenyl-4-hydroxybenzoate; Pphb-9; 3-Nonaprenyl-4-hydroxybenzoate; 38332-13-7; 4-hydroxy-3-all-trans-nonaprenylbenzoic acid; 4-hydroxy-3-[(2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenyl]benzoic acid; C03885; AC1O5ZN2; CHEBI:84501; 3-nonaprenyl-4-hydroxybenzoic acid; Q27157805; 4-hydroxy-3-[(2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaen-1-yl]benzoic acid; Benzoic acid, 4-hydroxy-3-(3,7,11,15,19,23,27,31,35-nonamethyl-2,6,10,14,18,22,26,30,34-hexatriacontanonaenyl)-
|
|
CAS | 38332-13-7 | |
PubChem CID | 6443777 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 751.2 | ALogp: | 17.9 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 27 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 57.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 55 | QED Weighted: | 0.07 |
Caco-2 Permeability: | -5.244 | MDCK Permeability: | 0.00000748 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.44 |
Human Intestinal Absorption (HIA): | 0.987 | 20% Bioavailability (F20%): | 0.025 |
30% Bioavailability (F30%): | 0.921 |
Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 100.91% |
Volume Distribution (VD): | -0.198 | Fu: | 0.24% |
CYP1A2-inhibitor: | 0.048 | CYP1A2-substrate: | 0.127 |
CYP2C19-inhibitor: | 0.14 | CYP2C19-substrate: | 0.037 |
CYP2C9-inhibitor: | 0.091 | CYP2C9-substrate: | 0.997 |
CYP2D6-inhibitor: | 0.073 | CYP2D6-substrate: | 0.259 |
CYP3A4-inhibitor: | 0.166 | CYP3A4-substrate: | 0.031 |
Clearance (CL): | 1.42 | Half-life (T1/2): | 0.155 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.851 |
Drug-inuced Liver Injury (DILI): | 0.001 | AMES Toxicity: | 0 |
Rat Oral Acute Toxicity: | 0 | Maximum Recommended Daily Dose: | 0.901 |
Skin Sensitization: | 0.992 | Carcinogencity: | 0.001 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.319 |
Respiratory Toxicity: | 0 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001427 | 0.490 | D01ZUA | 0.658 | ||||
ENC006119 | 0.312 | D09XWD | 0.400 | ||||
ENC001465 | 0.310 | D05XQE | 0.301 | ||||
ENC001466 | 0.310 | D03VFL | 0.299 | ||||
ENC004068 | 0.298 | D00FSV | 0.174 | ||||
ENC003494 | 0.286 | D0Q0PR | 0.173 | ||||
ENC003714 | 0.270 | D06BLQ | 0.173 | ||||
ENC001464 | 0.269 | D03LGG | 0.151 | ||||
ENC001716 | 0.268 | D0U5CE | 0.151 | ||||
ENC003133 | 0.262 | D0OR6A | 0.148 |