|
Name |
Asteltoxin
|
Molecular Formula | C23H30O7 | |
IUPAC Name* |
6-[(1E,3E,5E)-6-[(2R,3R,3aR,4R,5R,6aS)-2-ethyl-3,4-dihydroxy-3,3a-dimethyl-2,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl]hexa-1,3,5-trienyl]-4-methoxy-5-methylpyran-2-one
|
|
SMILES |
CC[C@@H]1[C@]([C@]2([C@H]([C@H](O[C@H]2O1)/C=C/C=C/C=C/C3=C(C(=CC(=O)O3)OC)C)O)C)(C)O
|
|
InChI |
InChI=1S/C23H30O7/c1-6-18-23(4,26)22(3)20(25)16(29-21(22)30-18)12-10-8-7-9-11-15-14(2)17(27-5)13-19(24)28-15/h7-13,16,18,20-21,25-26H,6H2,1-5H3/b8-7+,11-9+,12-10+/t16-,18-,20+,21+,22+,23+/m1/s1
|
|
InChIKey |
GPXPJKFETRLRAS-AHUKKWBBSA-N
|
|
Synonyms |
Asteltoxin; 79663-49-3; EV-Toxin; 6-[(1E,3E,5E)-6-[(2R,3R,3aR,4R,5R,6aS)-2-ethyl-3,4-dihydroxy-3,3a-dimethyl-2,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl]hexa-1,3,5-trienyl]-4-methoxy-5-methylpyran-2-one; 2H-Pyran-2-one,6-[(1E,3E,5E)-6-[(2R,3R,3aR,4R,5R,6aS)-5-ethylhexahydro-3,4-dihydroxy-3a,4-dimethylfuro[2,3-b]furan-2-yl]-1,3,5-hexatrien-1-yl]-4-methoxy-5-methyl-; (+)-asteltoxin; 2H-Pyran-2-one, 6-(6-(hexahydro-3,4-dihydroxy-3a,4-dimethyl-5-ethylfuro(2,3-b)furan-2-yl)-1,3,5-hexatrienyl)-4-methoxy-5-methyl-, (2R-(2-alpha(1E,3E,5E),3-alpha,3a-beta,4-beta,5-beta,6a-beta))-; CHEMBL3758613; CHEBI:175337; DTXSID101046614; ZINC1574763; 6-[(1E,3E,5E)-6-[(2R,3R,3aR,4R,5R,6aS)-2-ethyl-3,4-dihydroxy-3,3a-dimethyl-2,4,5,6a-tetrahydrouro[2,3-b]uran-5-yl]hexa-1,3,5-trienyl]-4-methoxy-5-methylpyran-2-one; NCGC00380401-01!6-[(1E,3E,5E)-6-[(2R,3R,3aR,4R,5R,6aS)-2-ethyl-3,4-dihydroxy-3,3a-dimethyl-2,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl]hexa-1,3,5-trienyl]-4-methoxy-5-methylpyran-2-one
|
|
CAS | 79663-49-3 | |
PubChem CID | 6438150 | |
ChEMBL ID | CHEMBL3758613 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 418.5 | ALogp: | 2.1 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 94.4 | Aromatic Rings: | 3 |
Heavy Atoms: | 30 | QED Weighted: | 0.682 |
Caco-2 Permeability: | -4.837 | MDCK Permeability: | 0.00001460 |
Pgp-inhibitor: | 0.177 | Pgp-substrate: | 0.242 |
Human Intestinal Absorption (HIA): | 0.034 | 20% Bioavailability (F20%): | 0.097 |
30% Bioavailability (F30%): | 0.016 |
Blood-Brain-Barrier Penetration (BBB): | 0.05 | Plasma Protein Binding (PPB): | 77.73% |
Volume Distribution (VD): | 0.978 | Fu: | 10.93% |
CYP1A2-inhibitor: | 0.206 | CYP1A2-substrate: | 0.833 |
CYP2C19-inhibitor: | 0.137 | CYP2C19-substrate: | 0.749 |
CYP2C9-inhibitor: | 0.049 | CYP2C9-substrate: | 0.891 |
CYP2D6-inhibitor: | 0.626 | CYP2D6-substrate: | 0.902 |
CYP3A4-inhibitor: | 0.49 | CYP3A4-substrate: | 0.269 |
Clearance (CL): | 2.384 | Half-life (T1/2): | 0.592 |
hERG Blockers: | 0.302 | Human Hepatotoxicity (H-HT): | 0.922 |
Drug-inuced Liver Injury (DILI): | 0.94 | AMES Toxicity: | 0.611 |
Rat Oral Acute Toxicity: | 0.467 | Maximum Recommended Daily Dose: | 0.801 |
Skin Sensitization: | 0.523 | Carcinogencity: | 0.029 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.017 |
Respiratory Toxicity: | 0.672 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005399 | 0.804 | D05QDC | 0.248 | ||||
ENC005400 | 0.760 | D0B1IP | 0.246 | ||||
ENC003443 | 0.657 | D0FG6M | 0.218 | ||||
ENC005994 | 0.538 | D0E9KA | 0.197 | ||||
ENC003144 | 0.538 | D0Q0PR | 0.196 | ||||
ENC005764 | 0.519 | D02YIZ | 0.188 | ||||
ENC005765 | 0.519 | D04JMQ | 0.186 | ||||
ENC005401 | 0.368 | D0Z1ZM | 0.185 | ||||
ENC001413 | 0.293 | D0G6AB | 0.180 | ||||
ENC005632 | 0.283 | D03HJK | 0.178 |