|
Name |
Sorbic acid vinyl ester
|
Molecular Formula | C8H10O2 | |
IUPAC Name* |
ethenyl (2E,4E)-hexa-2,4-dienoate
|
|
SMILES |
C/C=C/C=C/C(=O)OC=C
|
|
InChI |
InChI=1S/C8H10O2/c1-3-5-6-7-8(9)10-4-2/h3-7H,2H2,1H3/b5-3+,7-6+
|
|
InChIKey |
ZHIUCPNDVATEDB-TWTPFVCWSA-N
|
|
Synonyms |
Sorbic acid vinyl ester; 42739-26-4; Vinyl=sorbate; ethylene sorbate; ethenyl (2E,4E)-hexa-2,4-dienoate; SCHEMBL342553; 2,4-Hexadienoic acid vinyl ester; (2E,4E)-vinyl hexa-2,4-dienoate; MFCD00059387; AKOS025295317; Vinyl (2E,4E)-2,4-hexadienoate #
|
|
CAS | NA | |
PubChem CID | 5368936 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 138.16 | ALogp: | 2.1 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 10 | QED Weighted: | 0.259 |
Caco-2 Permeability: | -4.495 | MDCK Permeability: | 0.00002400 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.018 |
30% Bioavailability (F30%): | 0.108 |
Blood-Brain-Barrier Penetration (BBB): | 0.998 | Plasma Protein Binding (PPB): | 27.33% |
Volume Distribution (VD): | 0.818 | Fu: | 69.55% |
CYP1A2-inhibitor: | 0.507 | CYP1A2-substrate: | 0.168 |
CYP2C19-inhibitor: | 0.148 | CYP2C19-substrate: | 0.798 |
CYP2C9-inhibitor: | 0.079 | CYP2C9-substrate: | 0.672 |
CYP2D6-inhibitor: | 0.018 | CYP2D6-substrate: | 0.786 |
CYP3A4-inhibitor: | 0.035 | CYP3A4-substrate: | 0.351 |
Clearance (CL): | 6.465 | Half-life (T1/2): | 0.851 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.891 |
Drug-inuced Liver Injury (DILI): | 0.026 | AMES Toxicity: | 0.515 |
Rat Oral Acute Toxicity: | 0.83 | Maximum Recommended Daily Dose: | 0.94 |
Skin Sensitization: | 0.971 | Carcinogencity: | 0.87 |
Eye Corrosion: | 0.93 | Eye Irritation: | 0.773 |
Respiratory Toxicity: | 0.951 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001463 | 0.543 | D0A7MY | 0.205 | ||||
ENC001421 | 0.394 | D03ZFG | 0.164 | ||||
ENC004624 | 0.308 | D0FG6M | 0.157 | ||||
ENC005534 | 0.306 | D0B1IP | 0.155 | ||||
ENC000415 | 0.297 | D0T3NY | 0.153 | ||||
ENC002345 | 0.296 | D05QDC | 0.152 | ||||
ENC001725 | 0.289 | D0G3PI | 0.147 | ||||
ENC001748 | 0.286 | D00DKK | 0.147 | ||||
ENC002528 | 0.286 | D02DGU | 0.147 | ||||
ENC004396 | 0.283 | D0R3QY | 0.136 |