|
Name |
N-Methyl-N-benzyltetradecanamine
|
Molecular Formula | C22H39N | |
IUPAC Name* |
N-benzyl-N-methyltetradecan-1-amine
|
|
SMILES |
CCCCCCCCCCCCCCN(C)CC1=CC=CC=C1
|
|
InChI |
InChI=1S/C22H39N/c1-3-4-5-6-7-8-9-10-11-12-13-17-20-23(2)21-22-18-15-14-16-19-22/h14-16,18-19H,3-13,17,20-21H2,1-2H3
|
|
InChIKey |
LMODWEIPOHHCCQ-UHFFFAOYSA-N
|
|
Synonyms |
N-Methyl-N-benzyltetradecanamine; SCHEMBL278595; DTXSID501024999; N-Benzyl-N-methyl-1-tetradecanamine #
|
|
CAS | NA | |
PubChem CID | 584166 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 317.6 | ALogp: | 8.4 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 15 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 3.2 | Aromatic Rings: | 1 |
Heavy Atoms: | 23 | QED Weighted: | 0.323 |
Caco-2 Permeability: | -4.696 | MDCK Permeability: | 0.00000733 |
Pgp-inhibitor: | 0.1 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.029 |
30% Bioavailability (F30%): | 0.967 |
Blood-Brain-Barrier Penetration (BBB): | 0.869 | Plasma Protein Binding (PPB): | 96.81% |
Volume Distribution (VD): | 2.998 | Fu: | 1.30% |
CYP1A2-inhibitor: | 0.154 | CYP1A2-substrate: | 0.313 |
CYP2C19-inhibitor: | 0.484 | CYP2C19-substrate: | 0.897 |
CYP2C9-inhibitor: | 0.059 | CYP2C9-substrate: | 0.249 |
CYP2D6-inhibitor: | 0.989 | CYP2D6-substrate: | 0.404 |
CYP3A4-inhibitor: | 0.303 | CYP3A4-substrate: | 0.516 |
Clearance (CL): | 7.535 | Half-life (T1/2): | 0.067 |
hERG Blockers: | 0.985 | Human Hepatotoxicity (H-HT): | 0.084 |
Drug-inuced Liver Injury (DILI): | 0.348 | AMES Toxicity: | 0.005 |
Rat Oral Acute Toxicity: | 0.136 | Maximum Recommended Daily Dose: | 0.034 |
Skin Sensitization: | 0.956 | Carcinogencity: | 0.034 |
Eye Corrosion: | 0.977 | Eye Irritation: | 0.424 |
Respiratory Toxicity: | 0.936 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000509 | 0.607 | D0Z5SM | 0.458 | ||||
ENC000281 | 0.597 | D07ILQ | 0.443 | ||||
ENC000423 | 0.549 | D00AOJ | 0.411 | ||||
ENC000379 | 0.548 | D0P1RL | 0.408 | ||||
ENC000739 | 0.528 | D0OR6A | 0.396 | ||||
ENC000426 | 0.527 | D00FGR | 0.392 | ||||
ENC000427 | 0.526 | D05ATI | 0.390 | ||||
ENC000266 | 0.514 | D0O1PH | 0.357 | ||||
ENC000809 | 0.513 | D0R0UJ | 0.347 | ||||
ENC000489 | 0.513 | D07UHS | 0.330 |