|
Name |
1-Iodo-2-methylundecane
|
Molecular Formula | C12H25I | |
IUPAC Name* |
1-iodo-2-methylundecane
|
|
SMILES |
CCCCCCCCCC(C)CI
|
|
InChI |
InChI=1S/C12H25I/c1-3-4-5-6-7-8-9-10-12(2)11-13/h12H,3-11H2,1-2H3
|
|
InChIKey |
RTWBFGUVCAVDFO-UHFFFAOYSA-N
|
|
Synonyms |
1-Iodo-2-methylundecane; 73105-67-6; Undecane,1-iodo-2-methyl-; 1-iodo-2-methyl-undecane; SCHEMBL16046820; CHEBI:84222; DTXSID00337929; Q27157593
|
|
CAS | 73105-67-6 | |
PubChem CID | 545590 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 296.23 | ALogp: | 7.2 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 0.0 | Aromatic Rings: | 0 |
Heavy Atoms: | 13 | QED Weighted: | 0.3 |
Caco-2 Permeability: | -4.499 | MDCK Permeability: | 0.00001060 |
Pgp-inhibitor: | 0.012 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.263 |
30% Bioavailability (F30%): | 0.921 |
Blood-Brain-Barrier Penetration (BBB): | 0.481 | Plasma Protein Binding (PPB): | 97.57% |
Volume Distribution (VD): | 2.695 | Fu: | 2.11% |
CYP1A2-inhibitor: | 0.841 | CYP1A2-substrate: | 0.325 |
CYP2C19-inhibitor: | 0.553 | CYP2C19-substrate: | 0.228 |
CYP2C9-inhibitor: | 0.335 | CYP2C9-substrate: | 0.89 |
CYP2D6-inhibitor: | 0.172 | CYP2D6-substrate: | 0.082 |
CYP3A4-inhibitor: | 0.182 | CYP3A4-substrate: | 0.108 |
Clearance (CL): | 4.672 | Half-life (T1/2): | 0.117 |
hERG Blockers: | 0.086 | Human Hepatotoxicity (H-HT): | 0.065 |
Drug-inuced Liver Injury (DILI): | 0.716 | AMES Toxicity: | 0.096 |
Rat Oral Acute Toxicity: | 0.076 | Maximum Recommended Daily Dose: | 0.035 |
Skin Sensitization: | 0.939 | Carcinogencity: | 0.136 |
Eye Corrosion: | 0.994 | Eye Irritation: | 0.985 |
Respiratory Toxicity: | 0.928 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000850 | 0.705 | D05ATI | 0.407 | ||||
ENC000558 | 0.683 | D0G2KD | 0.380 | ||||
ENC001155 | 0.674 | D0Z5SM | 0.364 | ||||
ENC000490 | 0.674 | D0Y8DP | 0.351 | ||||
ENC000542 | 0.641 | D03ZJE | 0.338 | ||||
ENC000502 | 0.634 | D07ILQ | 0.333 | ||||
ENC000517 | 0.620 | D0Z5BC | 0.333 | ||||
ENC000797 | 0.610 | D05QNO | 0.333 | ||||
ENC001156 | 0.609 | D0P1RL | 0.321 | ||||
ENC001148 | 0.605 | D0XN8C | 0.319 |