|
Name |
3beta-Acetoxy-19-hydroxyandrost-5-en-17-one
|
Molecular Formula | C21H30O4 | |
IUPAC Name* |
[(3S,8R,9S,10S,13S,14S)-10-(hydroxymethyl)-13-methyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate
|
|
SMILES |
CC(=O)O[C@H]1CC[C@@]2([C@H]3CC[C@]4([C@H]([C@@H]3CC=C2C1)CCC4=O)C)CO
|
|
InChI |
InChI=1S/C21H30O4/c1-13(23)25-15-7-10-21(12-22)14(11-15)3-4-16-17-5-6-19(24)20(17,2)9-8-18(16)21/h3,15-18,22H,4-12H2,1-2H3/t15-,16-,17-,18-,20-,21+/m0/s1
|
|
InChIKey |
JDEYENFMPLMNPT-JPRZGNOKSA-N
|
|
Synonyms |
3beta-Acetoxy-19-hydroxyandrost-5-en-17-one; 2857-42-3; NSC-72259; 5J89F92ZYS; 3beta,19-Dihydroxyandrost-5-en-17-one 3-acetate; Androst-5-en-17-one, 3-(acetyloxy)-19-hydroxy-, (3.beta.)-; UNII-5J89F92ZYS; SCHEMBL11536556; CHEBI:79806; DTXSID40951249; NSC72259; ZINC4804640; 19-Hydroxy-17-oxoandrost-5-en-3-yl acetate; 19-Hydroxy-17-oxoandrost-5-en-3-yl acetate #; Androst-5-en-17-one,19-dihydroxy-, 3-acetate; 3beta-Acetoxy-19-hydroxyandrost-5-en-17-one, (+)-; Androst-5-en-17-one,3beta,19-dihydroxy-,3-acetate; Q27148942; 3.BETA.-ACETOXY-19-HYDROXYANDROST-5-EN-17-ONE; Androst-5-en-17-one, 3.beta.,19-dihydroxy-, 3-acetate; 3.BETA.,19-DIHYDROXYANDROST-5-EN-17-ONE 3-ACETATE; Androst-5-en-17-one, 3-(acetyloxy)-19-hydroxy-, (3beta)-; ANDROST-5-EN-17-ONE,3.BETA.,19-DIHYDROXY-,3-ACETATE; 3.BETA.-ACETOXY-19-HYDROXYANDROST-5-EN-17-ONE, (+)-
|
|
CAS | 2857-42-3 | |
PubChem CID | 251635 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 346.5 | ALogp: | 2.6 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 63.6 | Aromatic Rings: | 4 |
Heavy Atoms: | 25 | QED Weighted: | 0.602 |
Caco-2 Permeability: | -4.617 | MDCK Permeability: | 0.00003580 |
Pgp-inhibitor: | 0.807 | Pgp-substrate: | 0.315 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.046 |
30% Bioavailability (F30%): | 0.027 |
Blood-Brain-Barrier Penetration (BBB): | 0.315 | Plasma Protein Binding (PPB): | 79.25% |
Volume Distribution (VD): | 0.74 | Fu: | 8.45% |
CYP1A2-inhibitor: | 0.029 | CYP1A2-substrate: | 0.108 |
CYP2C19-inhibitor: | 0.021 | CYP2C19-substrate: | 0.542 |
CYP2C9-inhibitor: | 0.012 | CYP2C9-substrate: | 0.048 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.073 |
CYP3A4-inhibitor: | 0.72 | CYP3A4-substrate: | 0.349 |
Clearance (CL): | 9.122 | Half-life (T1/2): | 0.625 |
hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.446 |
Drug-inuced Liver Injury (DILI): | 0.36 | AMES Toxicity: | 0.316 |
Rat Oral Acute Toxicity: | 0.139 | Maximum Recommended Daily Dose: | 0.915 |
Skin Sensitization: | 0.262 | Carcinogencity: | 0.924 |
Eye Corrosion: | 0.169 | Eye Irritation: | 0.143 |
Respiratory Toxicity: | 0.969 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001475 | 0.500 | D0K0EK | 0.593 | ||||
ENC003369 | 0.477 | D06CNP | 0.485 | ||||
ENC001846 | 0.477 | D0B4RU | 0.473 | ||||
ENC001647 | 0.477 | D07BSQ | 0.411 | ||||
ENC002305 | 0.426 | D02CJX | 0.408 | ||||
ENC005068 | 0.422 | D06XMU | 0.387 | ||||
ENC000125 | 0.370 | D0D2VS | 0.379 | ||||
ENC000961 | 0.364 | D08TEJ | 0.376 | ||||
ENC001942 | 0.357 | D0I2SD | 0.366 | ||||
ENC001107 | 0.354 | D0Z1XD | 0.365 |