|
Name |
Alteichin
|
Molecular Formula | C20H14O6 | |
IUPAC Name* |
(1S,12aR,12bS)-1,4,9,12a-tetrahydroxy-2,12b-dihydro-1H-perylene-3,10-dione
|
|
SMILES |
C1[C@@H]([C@@H]2C3=C(C=CC(=C3C1=O)O)C4=C5[C@]2(C=CC(=O)C5=C(C=C4)O)O)O
|
|
InChI |
InChI=1S/C20H14O6/c21-10-3-1-8-9-2-4-11(22)17-12(23)5-6-20(26,18(9)17)19-14(25)7-13(24)16(10)15(8)19/h1-6,14,19,21-22,25-26H,7H2/t14-,19+,20-/m0/s1
|
|
InChIKey |
MTOHOIPTYJIUCH-KPOBHBOGSA-N
|
|
Synonyms |
Alteichin; alterperylenol; 88899-62-1; (+)-Alterperylenol; GRK18WHV7F; (1S,12aR,12bS)-1,4,9,12a-tetrahydroxy-2,12b-dihydro-1H-perylene-3,10-dione; C10295; 3,10-Perylenedione, 1,2,12a,12b-tetrahydro-1,4,9,12a-tetrahydroxy-, (1S,12aR,12bS)-; AC1L2PAW; UNII-GRK18WHV7F; Alterperylnol; AmbotzLS-1094; CHEBI:2614; CHEMBL4452280; SCHEMBL22837287; DTXSID10237401; ZINC4098645; MFCD08274557; AKOS030213167; Q27105736; 3,10-Perylenedione, 1,2,12a,12b-tetrahydro-1,4,9,12a-tetrahydroxy-, (1alpha,12abeta,12balpha)-(+)-; 3,10-PERYLENEDIONE, 1,2,12A,12B-TETRAHYDRO-1,4,9,12A-TETRAHYDROXY-, (1S-(1.ALPHA.,12A.BETA.,12B.ALPHA.))-
|
|
CAS | 88899-62-1 | |
PubChem CID | 125848 | |
ChEMBL ID | CHEMBL4452280 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 350.3 | ALogp: | 1.6 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 115.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 26 | QED Weighted: | 0.58 |
Caco-2 Permeability: | -5.413 | MDCK Permeability: | 0.00000818 |
Pgp-inhibitor: | 0.007 | Pgp-substrate: | 0.022 |
Human Intestinal Absorption (HIA): | 0.158 | 20% Bioavailability (F20%): | 0.268 |
30% Bioavailability (F30%): | 0.991 |
Blood-Brain-Barrier Penetration (BBB): | 0.051 | Plasma Protein Binding (PPB): | 94.75% |
Volume Distribution (VD): | 0.734 | Fu: | 2.87% |
CYP1A2-inhibitor: | 0.676 | CYP1A2-substrate: | 0.097 |
CYP2C19-inhibitor: | 0.168 | CYP2C19-substrate: | 0.057 |
CYP2C9-inhibitor: | 0.711 | CYP2C9-substrate: | 0.804 |
CYP2D6-inhibitor: | 0.668 | CYP2D6-substrate: | 0.142 |
CYP3A4-inhibitor: | 0.799 | CYP3A4-substrate: | 0.167 |
Clearance (CL): | 1.769 | Half-life (T1/2): | 0.076 |
hERG Blockers: | 0.156 | Human Hepatotoxicity (H-HT): | 0.224 |
Drug-inuced Liver Injury (DILI): | 0.438 | AMES Toxicity: | 0.914 |
Rat Oral Acute Toxicity: | 0.385 | Maximum Recommended Daily Dose: | 0.913 |
Skin Sensitization: | 0.897 | Carcinogencity: | 0.731 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.224 |
Respiratory Toxicity: | 0.599 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000883 | 0.726 | D07MGA | 0.291 | ||||
ENC005389 | 0.694 | D0R9WP | 0.289 | ||||
ENC000835 | 0.694 | D0R3JB | 0.286 | ||||
ENC003652 | 0.678 | D0H1AR | 0.279 | ||||
ENC003252 | 0.678 | D01XDL | 0.278 | ||||
ENC005311 | 0.678 | D0H6QU | 0.277 | ||||
ENC002281 | 0.600 | D04AIT | 0.275 | ||||
ENC000841 | 0.543 | D0R6RC | 0.274 | ||||
ENC005474 | 0.485 | D07JHH | 0.274 | ||||
ENC000987 | 0.485 | D08LTU | 0.272 |